Tanikolide
| Internal ID | 04e6adf0-2ba4-4e6b-ad74-366745ed07d7 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols > Long-chain fatty alcohols |
| IUPAC Name | (6R)-6-(hydroxymethyl)-6-undecyloxan-2-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H32O3/c1-2-3-4-5-6-7-8-9-10-13-17(15-18)14-11-12-16(19)20-17/h18H,2-15H2,1H3/t17-/m1/s1 |
| InChI Key | NLAYXWYCDWDTBF-QGZVFWFLSA-N |
| Popularity | 25 references in papers |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.23514488 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 5.30 |
| (+)-Tanikolide |
| (6R)-6-(hydroxymethyl)-6-undecyloxan-2-one |
| CHEMBL479498 |
| SCHEMBL9902905 |
| DTXSID401037008 |
| 248278-40-2 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 |
176 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL299 | P17252 | Protein kinase C alpha | 98.99% | 98.03% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.80% | 98.95% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 93.51% | 89.63% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.93% | 91.11% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 92.59% | 97.79% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.93% | 96.09% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 87.80% | 91.81% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.23% | 95.56% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.89% | 100.00% |
| CHEMBL1977 | P11473 | Vitamin D receptor | 83.35% | 99.43% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.93% | 97.25% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.72% | 93.99% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.71% | 92.86% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.51% | 90.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 5276592 |
| LOTUS | LTS0133268 |
| wikiData | Q105181249 |