Tambjamine E
| Internal ID | 4f446387-59cc-4ff9-b40e-1a2ac4840b20 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Ethers > Alkyl aryl ethers |
| IUPAC Name | N-ethyl-1-[3-methoxy-5-(1H-pyrrol-2-yl)-1H-pyrrol-2-yl]methanimine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C12H15N3O/c1-3-13-8-11-12(16-2)7-10(15-11)9-5-4-6-14-9/h4-8,14-15H,3H2,1-2H3 |
| InChI Key | WUQYWAZRDRWKFZ-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.121512110 g/mol |
| Topological Polar Surface Area (TPSA) | 53.20 Ų |
| XlogP | 1.40 |
| 4U45NBS9DJ |
| 126584-10-9 |
| ethyl({[(5Z)-4-methoxy-1'H,5H-[2,2'-bipyrrol]-5-ylidene]methyl})amine |
| Ethanamine, N-[(Z)-[3-methoxy-5-(1H-pyrrol-2-yl)-2H-pyrrol-2-ylidene]methyl]- |
| N-[(Z)-[3-Methoxy-5-(1H-pyrrol-2-yl)-2H-pyrrol-2-ylidene]methyl]ethanamine |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.51% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.23% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.78% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.37% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.48% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.44% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.64% | 93.99% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.70% | 89.62% |
| CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 86.62% | 89.32% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.29% | 94.45% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.44% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.30% | 99.17% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.04% | 91.71% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 80.90% | 85.30% |
| CHEMBL4578 | Q14680 | Maternal embryonic leucine zipper kinase | 80.45% | 81.58% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 80.04% | 92.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 135475511 |
| LOTUS | LTS0130145 |
| wikiData | Q104403163 |