Taiwanin E
Internal ID | 57797463-17ec-4c24-9395-e6ca2e6f8325 |
Taxonomy | Lignans, neolignans and related compounds > Arylnaphthalene lignans |
IUPAC Name | 9-(1,3-benzodioxol-5-yl)-5-hydroxy-6H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
SMILES (Canonical) | C1C2=C(C3=CC4=C(C=C3C(=C2C(=O)O1)C5=CC6=C(C=C5)OCO6)OCO4)O |
SMILES (Isomeric) | C1C2=C(C3=CC4=C(C=C3C(=C2C(=O)O1)C5=CC6=C(C=C5)OCO6)OCO4)O |
InChI | InChI=1S/C20H12O7/c21-19-11-5-16-15(26-8-27-16)4-10(11)17(18-12(19)6-23-20(18)22)9-1-2-13-14(3-9)25-7-24-13/h1-5,21H,6-8H2 |
InChI Key | YYFMUDJSHVYJGD-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C20H12O7 |
Molecular Weight | 364.30 g/mol |
Exact Mass | 364.05830272 g/mol |
Topological Polar Surface Area (TPSA) | 83.40 Ų |
XlogP | 3.50 |
22743-05-1 |
5-(1,3-Benzodioxol-5-yl)-9-hydroxyfuro[3',4' |
CHEMBL468453 |
SCHEMBL15363973 |
YYFMUDJSHVYJGD-UHFFFAOYSA-N |
AKOS040763348 |
9-(1,3-benzodioxol-5-yl)-5-hydroxy-6H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
5-benzo[1,3]dioxol-5-yl-9-hydroxy-8h-furo[3',4':6,7]naphtho[2,3-d][1,3]dioxol-6-one |
9-(1,3-benzodioxol-5-yl)-5-hydroxy-6H-isobenzofuro[5,6-f][1,3]benzodioxol-8-one |
Furo[3',4':6,7]naphtho[2,3-d]-1,3-dioxol-6(8H)-one, 5-(1,3-benzodioxol-5-yl)-9-hydroxy- |
![2D Structure of Taiwanin E 2D Structure of Taiwanin E](https://plantaedb.com/storage/docs/compounds/2023/07/taiwanin-e.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.36% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.27% | 91.49% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.20% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 94.28% | 98.95% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 93.55% | 94.80% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.52% | 89.00% |
CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 93.23% | 93.24% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.92% | 95.56% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.39% | 96.77% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 91.77% | 80.96% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.73% | 86.33% |
CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 89.51% | 98.21% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.30% | 93.40% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 86.78% | 96.12% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.75% | 92.62% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.16% | 99.15% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.60% | 85.14% |
CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 82.16% | 85.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.75% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.50% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cleistanthus collinus |
Justicia patentiflora |
Justicia procumbens |
Taiwania cryptomerioides |
PubChem | 493164 |
NPASS | NPC198796 |
ChEMBL | CHEMBL468453 |
LOTUS | LTS0023799 |
wikiData | Q104398846 |