Taiwaniaquinone
Internal ID | bf23f411-6eff-43c6-bf75-11e0f68dc28b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | (4aS,9R,9aS)-6-methoxy-1,1,4a-trimethyl-5,8-dioxo-7-propan-2-yl-3,4,9,9a-tetrahydro-2H-fluorene-9-carbaldehyde |
SMILES (Canonical) | CC(C)C1=C(C(=O)C2=C(C1=O)C(C3C2(CCCC3(C)C)C)C=O)OC |
SMILES (Isomeric) | CC(C)C1=C(C(=O)C2=C(C1=O)[C@@H]([C@@H]3[C@@]2(CCCC3(C)C)C)C=O)OC |
InChI | InChI=1S/C21H28O4/c1-11(2)13-16(23)14-12(10-22)19-20(3,4)8-7-9-21(19,5)15(14)17(24)18(13)25-6/h10-12,19H,7-9H2,1-6H3/t12-,19-,21+/m0/s1 |
InChI Key | VTLCOGFYOXOPRS-VTOVKPRRSA-N |
Popularity | 4 references in papers |
Molecular Formula | C21H28O4 |
Molecular Weight | 344.40 g/mol |
Exact Mass | 344.19875937 g/mol |
Topological Polar Surface Area (TPSA) | 60.40 Ų |
XlogP | 4.00 |
TaiwaniaquinoneF |
CHEMBL1088627 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.54% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.69% | 97.25% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 94.25% | 95.69% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.54% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 92.94% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.50% | 95.56% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.24% | 96.77% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.91% | 94.75% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.65% | 82.69% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.20% | 96.09% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.13% | 97.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.08% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.22% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.86% | 95.89% |
CHEMBL4072 | P07858 | Cathepsin B | 81.73% | 93.67% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.34% | 91.07% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.80% | 96.38% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.03% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Taiwania cryptomerioides |
PubChem | 11290884 |
NPASS | NPC8091 |
ChEMBL | CHEMBL1088627 |
LOTUS | LTS0069423 |
wikiData | Q105292822 |