Subterisin
| Internal ID | ce792154-599d-4b94-b495-02e496caef8c |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | 2-[(3S,14S,17S,20S,23S,29S)-14-[[(2S)-1-[[2-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-5-amino-1-[[(2S)-1-[(2S)-2-(carboxymethylcarbamoyl)pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-2-oxoethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamoyl]-17-[(2S)-butan-2-yl]-20-[3-(diaminomethylideneamino)propyl]-2,8,11,16,19,22,25,28-octaoxo-1,7,10,15,18,21,24,27-octazatricyclo[27.3.0.03,7]dotriacontan-23-yl]acetic acid |
| SMILES (Canonical) | CCC(C)C1C(=O)NC(CCC(=O)NCC(=O)N2CCCC2C(=O)N3CCCC3C(=O)NCC(=O)NC(C(=O)NC(C(=O)N1)CCCN=C(N)N)CC(=O)O)C(=O)NC(CC4=CC=CC=C4)C(=O)NCC(=O)NC(C(C)C)C(=O)NC(CC(C)C)C(=O)NC(C)C(=O)NC(CCC(=O)N)C(=O)NC(CC(C)C)C(=O)N5CCCC5C(=O)NCC(=O)O |
| SMILES (Isomeric) | CC[C@H](C)[C@H]1C(=O)N[C@@H](CCC(=O)NCC(=O)N2CCC[C@H]2C(=O)N3CCC[C@H]3C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N1)CCCN=C(N)N)CC(=O)O)C(=O)N[C@@H](CC4=CC=CC=C4)C(=O)NCC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC(C)C)C(=O)N5CCC[C@H]5C(=O)NCC(=O)O |
| InChI | InChI=1S/C78H121N21O22/c1-10-43(8)64-75(119)91-48(25-27-57(101)83-38-60(104)97-29-17-23-55(97)77(121)99-31-16-22-54(99)72(116)85-36-58(102)88-51(35-61(105)106)71(115)90-46(69(113)96-64)20-14-28-82-78(80)81)67(111)92-50(34-45-18-12-11-13-19-45)66(110)84-37-59(103)95-63(42(6)7)74(118)93-49(32-40(2)3)70(114)87-44(9)65(109)89-47(24-26-56(79)100)68(112)94-52(33-41(4)5)76(120)98-30-15-21-53(98)73(117)86-39-62(107)108/h11-13,18-19,40-44,46-55,63-64H,10,14-17,20-39H2,1-9H3,(H2,79,100)(H,83,101)(H,84,110)(H,85,116)(H,86,117)(H,87,114)(H,88,102)(H,89,109)(H,90,115)(H,91,119)(H,92,111)(H,93,118)(H,94,112)(H,95,103)(H,96,113)(H,105,106)(H,107,108)(H4,80,81,82)/t43-,44-,46-,47-,48-,49-,50-,51-,52-,53-,54-,55-,63-,64-/m0/s1 |
| InChI Key | FUHIJKMLJFMUPU-HYFOAOAQSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C78H121N21O22 |
| Molecular Weight | 1704.90 g/mol |
| Exact Mass | 1703.89950457 g/mol |
| Topological Polar Surface Area (TPSA) | 650.00 Ų |
| XlogP | -2.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 100.00% | 98.95% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.62% | 97.64% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.56% | 96.61% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 99.44% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.26% | 96.09% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 99.03% | 98.33% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 98.97% | 82.38% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 98.96% | 94.66% |
| CHEMBL236 | P41143 | Delta opioid receptor | 98.92% | 99.35% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 98.88% | 94.45% |
| CHEMBL1801 | P00747 | Plasminogen | 98.78% | 92.44% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 98.64% | 96.67% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 97.83% | 98.94% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 97.71% | 89.63% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 97.49% | 82.69% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 97.12% | 98.24% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 96.72% | 97.14% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 96.64% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.46% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.24% | 91.11% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 96.04% | 88.42% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 95.93% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.75% | 94.45% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 95.70% | 97.23% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 95.42% | 95.52% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 95.32% | 93.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.06% | 90.08% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 94.75% | 96.47% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.45% | 90.71% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 93.82% | 96.31% |
| CHEMBL4071 | P08311 | Cathepsin G | 93.79% | 94.64% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 92.33% | 95.38% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.33% | 95.56% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 92.26% | 97.43% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.06% | 99.17% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 91.86% | 95.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 91.30% | 93.03% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 90.45% | 91.81% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.43% | 93.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.18% | 95.89% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 90.05% | 96.67% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 90.00% | 83.14% |
| CHEMBL4801 | P29466 | Caspase-1 | 89.47% | 96.85% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.60% | 98.59% |
| CHEMBL204 | P00734 | Thrombin | 88.40% | 96.01% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 88.19% | 95.00% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 87.74% | 96.11% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 87.36% | 96.03% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.21% | 100.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.57% | 98.75% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 86.49% | 98.05% |
| CHEMBL5028 | O14672 | ADAM10 | 86.37% | 97.50% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 86.26% | 98.10% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 86.07% | 89.33% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 85.94% | 90.20% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 85.92% | 82.50% |
| CHEMBL3202 | P48147 | Prolyl endopeptidase | 85.86% | 90.65% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 85.53% | 88.56% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.38% | 96.90% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.51% | 96.00% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 84.23% | 95.62% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 83.75% | 96.67% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 83.35% | 92.67% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.30% | 95.50% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 83.27% | 96.25% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 82.73% | 92.12% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 82.33% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.10% | 99.23% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 80.81% | 99.23% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 80.07% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139591211 |
| LOTUS | LTS0133051 |
| wikiData | Q105001709 |