Subelliptenone G
| Internal ID | 20002438-6d4a-40e1-ab96-c15625a05f13 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 1,4,5-trihydroxyxanthen-9-one |
| SMILES (Canonical) | C1=CC2=C(C(=C1)O)OC3=C(C=CC(=C3C2=O)O)O |
| SMILES (Isomeric) | C1=CC2=C(C(=C1)O)OC3=C(C=CC(=C3C2=O)O)O |
| InChI | InChI=1S/C13H8O5/c14-7-4-5-9(16)13-10(7)11(17)6-2-1-3-8(15)12(6)18-13/h1-5,14-16H |
| InChI Key | HFSVZCUBASBXKP-UHFFFAOYSA-N |
| Popularity | 7 references in papers |
| Molecular Formula | C13H8O5 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.03717335 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 2.40 |
| 162473-22-5 |
| Subelliptene G |
| 1,4,5-trihydroxyxanthen-9-one |
| 1,4,5-TRIHYDROXY-9H-XANTHEN-9-ONE |
| 1,4,5-trihydroxyxanthone |
| CHEMBL4081488 |
| SCHEMBL8958340 |
| HY-N1197 |
| BDBM50268299 |
| AKOS032948664 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.28% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.80% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.42% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.10% | 89.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.19% | 93.99% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.32% | 91.49% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.61% | 99.15% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.51% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.70% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.21% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.74% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Agasthiyamalaia pauciflora |
| Garcinia dulcis |
| Garcinia subelliptica |
| Garcinia vieillardii |
| Hypericum ellipticum |
| PubChem | 9916414 |
| LOTUS | LTS0224656 |
| wikiData | Q105027518 |