Strychnofendlerine
Internal ID | 78ff2ef6-fa01-4d06-8b65-09f13d63d50d |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | 8-acetyl-13,16-dimethyl-12-oxa-8,16-diazapentacyclo[8.8.3.01,9.02,7.014,21]henicosa-2,4,6-trien-19-one |
SMILES (Canonical) | CC1C2CN(CCC34C(C(C2CC3=O)CO1)N(C5=CC=CC=C45)C(=O)C)C |
SMILES (Isomeric) | CC1C2CN(CCC34C(C(C2CC3=O)CO1)N(C5=CC=CC=C45)C(=O)C)C |
InChI | InChI=1S/C22H28N2O3/c1-13-16-11-23(3)9-8-22-18-6-4-5-7-19(18)24(14(2)25)21(22)17(12-27-13)15(16)10-20(22)26/h4-7,13,15-17,21H,8-12H2,1-3H3 |
InChI Key | FMZMLKGLGADCPQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H28N2O3 |
Molecular Weight | 368.50 g/mol |
Exact Mass | 368.20999276 g/mol |
Topological Polar Surface Area (TPSA) | 49.80 Ų |
XlogP | 1.40 |
62278-92-6 |
STRYCHNOFENDLERINE |
CHEMBL1983150 |
DTXSID70316302 |
NSC-301744 |
NCI60_002536 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.35% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.95% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.28% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.26% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.80% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.14% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.53% | 90.71% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 89.13% | 85.11% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 89.11% | 100.00% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 87.98% | 93.65% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 86.08% | 96.39% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.64% | 94.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.57% | 82.69% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.15% | 94.42% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 83.63% | 98.46% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 82.82% | 95.62% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.27% | 99.23% |
CHEMBL5028 | O14672 | ADAM10 | 80.89% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos diplotricha |
Strychnos fendleri |
Strychnos myrtoides |
Strychnos soubrensis |
PubChem | 327292 |
LOTUS | LTS0069114 |
wikiData | Q82070021 |