Strychnobrasiline
Internal ID | 33762eba-30c2-4795-9cbe-2a494ad6d9c8 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | (9S,10R,13R,14E,21R)-8-acetyl-13,16-dimethyl-12-oxa-8,16-diazapentacyclo[8.8.3.01,9.02,7.014,21]henicosa-2,4,6,14-tetraen-19-one |
SMILES (Canonical) | CC1C2=CN(CCC34C(C(C2CC3=O)CO1)N(C5=CC=CC=C45)C(=O)C)C |
SMILES (Isomeric) | C[C@@H]1/C/2=C/N(CCC34[C@H]([C@@H]([C@H]2CC3=O)CO1)N(C5=CC=CC=C45)C(=O)C)C |
InChI | InChI=1S/C22H26N2O3/c1-13-16-11-23(3)9-8-22-18-6-4-5-7-19(18)24(14(2)25)21(22)17(12-27-13)15(16)10-20(22)26/h4-7,11,13,15,17,21H,8-10,12H2,1-3H3/b16-11-/t13-,15+,17-,21+,22?/m1/s1 |
InChI Key | XZIACDKZDCVKKQ-UJBRFIQFSA-N |
Popularity | 5 references in papers |
Molecular Formula | C22H26N2O3 |
Molecular Weight | 366.50 g/mol |
Exact Mass | 366.19434270 g/mol |
Topological Polar Surface Area (TPSA) | 49.80 Ų |
XlogP | 0.90 |
34227-00-4 |
1-Acetyl-20,21-didehydro-17,19-epoxy-4-methyl-3,4-secocuran-3-one |
(19R)-1-Acetyl-20,21-didehydro-17,19-epoxy-4-methyl-3,4-secocuran-3-one |
3,4-Secocuran-3-one, 1-acetyl-20,21-didehydro-17,19-epoxy-4-methyl-, (19R)- |
(9S,10R,13R,14E,21R)-8-acetyl-13,16-dimethyl-12-oxa-8,16-diazapentacyclo[8.8.3.01,9.02,7.014,21]henicosa-2,4,6,14-tetraen-19-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.90% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.33% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.93% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 92.32% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.16% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.47% | 95.56% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 89.97% | 100.00% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 88.74% | 85.11% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.04% | 90.00% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.96% | 93.65% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.53% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.92% | 99.23% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 83.88% | 94.42% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.68% | 94.00% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 83.49% | 96.39% |
CHEMBL5028 | O14672 | ADAM10 | 82.94% | 97.50% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 82.37% | 95.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.29% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos diplotricha |
Strychnos mattogrossensis |
Strychnos myrtoides |
Strychnos soubrensis |
PubChem | 3081468 |
LOTUS | LTS0074083 |
wikiData | Q104395264 |