Strychnobiflavone
| Internal ID | 982e3de4-a5bc-4250-973c-d4d00d4932e0 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 3-O-methylated flavonoids |
| IUPAC Name | 8-[6-(5,7-dihydroxy-3-methoxy-4-oxochromen-2-yl)-2,3-dihydroxyphenyl]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-methoxychromen-4-one |
| SMILES (Canonical) | COC1=C(OC2=C(C1=O)C(=CC(=C2C3=C(C=CC(=C3O)O)C4=C(C(=O)C5=C(C=C(C=C5O4)O)O)OC)O)O)C6=CC(=C(C=C6)O)O |
| SMILES (Isomeric) | COC1=C(OC2=C(C1=O)C(=CC(=C2C3=C(C=CC(=C3O)O)C4=C(C(=O)C5=C(C=C(C=C5O4)O)O)OC)O)O)C6=CC(=C(C=C6)O)O |
| InChI | InChI=1S/C32H22O14/c1-43-31-27(42)24-19(39)10-18(38)23(30(24)46-28(31)11-3-5-14(34)16(36)7-11)21-13(4-6-15(35)25(21)40)29-32(44-2)26(41)22-17(37)8-12(33)9-20(22)45-29/h3-10,33-40H,1-2H3 |
| InChI Key | HCKBBCZNQQSLQT-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C32H22O14 |
| Molecular Weight | 630.50 g/mol |
| Exact Mass | 630.10095537 g/mol |
| Topological Polar Surface Area (TPSA) | 233.00 Ų |
| XlogP | 4.70 |
| 96253-81-5 |
| 8-[6-(5,7-dihydroxy-3-methoxy-4-oxochromen-2-yl)-2,3-dihydroxyphenyl]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-methoxychromen-4-one |
| DTXSID40242184 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.53% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.36% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.27% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.95% | 99.15% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.23% | 91.49% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.65% | 94.00% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 94.23% | 96.12% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.89% | 86.33% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 93.47% | 95.64% |
| CHEMBL3194 | P02766 | Transthyretin | 92.65% | 90.71% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 90.26% | 80.78% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 90.20% | 98.21% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.20% | 95.56% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 88.51% | 98.35% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 88.26% | 98.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.89% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.82% | 94.73% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.76% | 99.23% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 87.45% | 94.42% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.66% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.34% | 90.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.73% | 96.21% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 82.10% | 93.31% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 81.46% | 95.53% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.33% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Strychnos pseudoquina |
| PubChem | 5491475 |
| LOTUS | LTS0123294 |
| wikiData | Q83125818 |