Streptopyrazinone B
| Internal ID | e2dd23fc-84cd-43d0-8baa-8034d7bc2216 |
| Taxonomy | Organoheterocyclic compounds > Diazines > Pyrazines |
| IUPAC Name | N-[4-[5-(2-methylpropyl)-6-oxo-1H-pyrazin-2-yl]butyl]acetamide |
| SMILES (Canonical) | CC(C)CC1=NC=C(NC1=O)CCCCNC(=O)C |
| SMILES (Isomeric) | CC(C)CC1=NC=C(NC1=O)CCCCNC(=O)C |
| InChI | InChI=1S/C14H23N3O2/c1-10(2)8-13-14(19)17-12(9-16-13)6-4-5-7-15-11(3)18/h9-10H,4-8H2,1-3H3,(H,15,18)(H,17,19) |
| InChI Key | PLJRJPNBIDCWND-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17902698 g/mol |
| Topological Polar Surface Area (TPSA) | 70.60 Ų |
| XlogP | 0.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.34% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.30% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.07% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.27% | 83.82% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 94.21% | 98.59% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.98% | 94.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.75% | 94.73% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.35% | 98.75% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 92.51% | 89.34% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.90% | 91.11% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.87% | 90.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.48% | 99.17% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 84.60% | 81.11% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.77% | 96.90% |
| CHEMBL4296013 | Q5VWK5 | Interleukin-23 receptor | 83.61% | 88.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.49% | 94.00% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 83.31% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.26% | 90.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.41% | 95.50% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 82.05% | 92.29% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.36% | 97.21% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.78% | 90.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139590253 |
| LOTUS | LTS0214638 |
| wikiData | Q104194970 |