Streptophenazine E
| Internal ID | d3dc4686-41b1-4e89-b505-cfd3a068de59 |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinoxalines > Phenazines and derivatives |
| IUPAC Name | methyl 6-(3-hydroxy-1-methoxy-1-oxoheptan-2-yl)phenazine-1-carboxylate |
| SMILES (Canonical) | CCCCC(C(C1=C2C(=CC=C1)N=C3C(=N2)C=CC=C3C(=O)OC)C(=O)OC)O |
| SMILES (Isomeric) | CCCCC(C(C1=C2C(=CC=C1)N=C3C(=N2)C=CC=C3C(=O)OC)C(=O)OC)O |
| InChI | InChI=1S/C22H24N2O5/c1-4-5-12-17(25)18(22(27)29-3)13-8-6-10-15-19(13)23-16-11-7-9-14(20(16)24-15)21(26)28-2/h6-11,17-18,25H,4-5,12H2,1-3H3 |
| InChI Key | IRNKVLMOMFBESJ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.16852187 g/mol |
| Topological Polar Surface Area (TPSA) | 98.60 Ų |
| XlogP | 3.50 |
| methyl 6-(3-hydroxy-1-methoxy-1-oxoheptan-2-yl)phenazine-1-carboxylate |
| RefChem:185961 |
| Methyl 6-(3-hydroxy-1-methoxy-1-oxoheptan-2-yl)phenazine-1-carboxylic acid |
| 1018439-67-2 |
| CHEMBL522554 |
| SCHEMBL29884170 |
| CHEBI:226778 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.64% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.64% | 96.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 96.70% | 89.63% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.75% | 90.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.51% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.07% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.15% | 99.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.74% | 93.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.77% | 96.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.76% | 95.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.60% | 99.23% |
| CHEMBL3891 | P07384 | Calpain 1 | 88.82% | 93.04% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.97% | 98.75% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.95% | 91.49% |
| CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 86.07% | 91.65% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 85.65% | 93.31% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 83.81% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.56% | 91.11% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.41% | 100.00% |
| CHEMBL235 | P37231 | Peroxisome proliferator-activated receptor gamma | 81.28% | 95.39% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 80.69% | 92.08% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.23% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 24879216 |
| LOTUS | LTS0216661 |
| wikiData | Q104169046 |