Streptonigrone
| Internal ID | 9844ca12-e577-46eb-b88d-8504be9d863b |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Bipyridines and oligopyridines |
| IUPAC Name | 7-amino-2-[3-amino-4-(2-hydroxy-3,4-dimethoxyphenyl)-5-methyl-6-oxo-1H-pyridin-2-yl]-6-methoxyquinoline-5,8-dione |
| SMILES (Canonical) | CC1=C(C(=C(NC1=O)C2=NC3=C(C=C2)C(=O)C(=C(C3=O)N)OC)N)C4=C(C(=C(C=C4)OC)OC)O |
| SMILES (Isomeric) | CC1=C(C(=C(NC1=O)C2=NC3=C(C=C2)C(=O)C(=C(C3=O)N)OC)N)C4=C(C(=C(C=C4)OC)OC)O |
| InChI | InChI=1S/C24H22N4O7/c1-9-14(10-6-8-13(33-2)22(34-3)19(10)29)15(25)18(28-24(9)32)12-7-5-11-17(27-12)21(31)16(26)23(35-4)20(11)30/h5-8,29H,25-26H2,1-4H3,(H,28,32) |
| InChI Key | KDHCNBXWSJRGJW-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C24H22N4O7 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.14884905 g/mol |
| Topological Polar Surface Area (TPSA) | 176.00 Ų |
| XlogP | 0.60 |
| 96684-38-7 |
| DTXSID20914397 |
| 5,8-Quinolinedione, 7-amino-2-(3-amino-1,6-dihydro-4-(2-hydroxy-3,4-dimethoxyphenyl)-5-methyl-6-oxo-2-pyridinyl)-6-methoxy- |
| 7-Amino-2-[3-amino-6-hydroxy-4-(2-hydroxy-3,4-dimethoxyphenyl)-5-methylpyridin-2-yl]-6-methoxyquinoline-5,8-dione |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.60% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.82% | 94.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.67% | 94.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.39% | 99.23% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 92.15% | 96.67% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.10% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.54% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.95% | 86.33% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.79% | 94.42% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.29% | 91.49% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.03% | 99.15% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 83.94% | 95.48% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.43% | 96.09% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.36% | 93.65% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.26% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 126029 |
| LOTUS | LTS0047121 |
| wikiData | Q77279130 |