Streptomyceamide B
| Internal ID | 419f5ac0-ba49-4aa7-8d1d-b1bbf46e57bd |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Alpha amino acid esters |
| IUPAC Name | N-[(3R,4R)-3-amino-4-methyl-2,6-dioxo-3,4-dihydro-1,5-benzodioxocin-10-yl]formamide |
| SMILES (Canonical) | CC1C(C(=O)OC2=C(C=CC=C2NC=O)C(=O)O1)N |
| SMILES (Isomeric) | C[C@@H]1[C@H](C(=O)OC2=C(C=CC=C2NC=O)C(=O)O1)N |
| InChI | InChI=1S/C12H12N2O5/c1-6-9(13)12(17)19-10-7(11(16)18-6)3-2-4-8(10)14-5-15/h2-6,9H,13H2,1H3,(H,14,15)/t6-,9-/m1/s1 |
| InChI Key | KXDYKUVJWWWXKR-HZGVNTEJSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.07462149 g/mol |
| Topological Polar Surface Area (TPSA) | 108.00 Ų |
| XlogP | 0.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.79% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.37% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.85% | 91.49% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.40% | 99.23% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.36% | 94.80% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.31% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.25% | 94.73% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 85.08% | 89.34% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.44% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.97% | 96.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.52% | 82.69% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.32% | 98.75% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.31% | 91.11% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.30% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 91028654 |
| LOTUS | LTS0076038 |
| wikiData | Q77511611 |