Streptomonomicin
| Internal ID | 3cffedc4-26e5-4807-b964-d33db50e0708 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | (2S)-1-[(2S)-2-[[(2S,3S)-2-[[(2S)-2-[[(2S,3S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-1-[(2S)-2-[[2-[[(2S)-2-[[(2S,3S)-2-[[(3S,6S,12S,15S,19S,22S,25S,28S)-22-(2-amino-2-oxoethyl)-3,6,15-tris(hydroxymethyl)-25-[(4-hydroxyphenyl)methyl]-12-(2-methylpropyl)-2,5,8,11,14,17,21,24,27-nonaoxo-1,4,7,10,13,16,20,23,26-nonazabicyclo[26.3.0]hentriacontane-19-carbonyl]amino]-3-methylpentanoyl]amino]-4-methylpentanoyl]amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]propanoyl]amino]-4-methylpentanoyl]amino]-3-methylpentanoyl]amino]-3-methylbutanoyl]amino]-3-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES (Canonical) | CCC(C)C(C(=O)NC(CC(C)C)C(=O)NCC(=O)NC(CC1=CC=C(C=C1)O)C(=O)N2CCCC2C(=O)NC(C)C(=O)NC(CC(C)C)C(=O)NC(C(C)CC)C(=O)NC(C(C)C)C(=O)NC(C(C)CC)C(=O)NC(CC3=CC=C(C=C3)O)C(=O)N4CCCC4C(=O)O)NC(=O)C5CC(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)N6CCCC6C(=O)NC(C(=O)NC(C(=O)N5)CC(=O)N)CC7=CC=C(C=C7)O)CO)CO)CC(C)C)CO |
| SMILES (Isomeric) | CC[C@H](C)[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N2CCC[C@H]2C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC3=CC=C(C=C3)O)C(=O)N4CCC[C@H]4C(=O)O)NC(=O)[C@@H]5CC(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N6CCC[C@H]6C(=O)N[C@H](C(=O)N[C@H](C(=O)N5)CC(=O)N)CC7=CC=C(C=C7)O)CO)CO)CC(C)C)CO |
| InChI | InChI=1S/C107H160N22O30/c1-16-57(12)86(124-95(146)72-47-82(137)113-75(50-130)96(147)116-67(40-53(4)5)90(141)110-49-84(139)114-76(51-131)97(148)122-77(52-132)106(157)128-38-20-23-79(128)99(150)119-70(43-61-25-31-64(133)32-26-61)92(143)117-71(46-81(108)136)93(144)118-72)101(152)120-68(41-54(6)7)91(142)109-48-83(138)112-73(44-62-27-33-65(134)34-28-62)104(155)127-37-19-22-78(127)98(149)111-60(15)89(140)115-69(42-55(8)9)94(145)125-88(59(14)18-3)103(154)123-85(56(10)11)100(151)126-87(58(13)17-2)102(153)121-74(45-63-29-35-66(135)36-30-63)105(156)129-39-21-24-80(129)107(158)159/h25-36,53-60,67-80,85-88,130-135H,16-24,37-52H2,1-15H3,(H2,108,136)(H,109,142)(H,110,141)(H,111,149)(H,112,138)(H,113,137)(H,114,139)(H,115,140)(H,116,147)(H,117,143)(H,118,144)(H,119,150)(H,120,152)(H,121,153)(H,122,148)(H,123,154)(H,124,146)(H,125,145)(H,126,151)(H,158,159)/t57-,58-,59-,60-,67-,68-,69-,70-,71-,72-,73-,74-,75-,76-,77-,78-,79-,80-,85-,86-,87-,88-/m0/s1 |
| InChI Key | ZUTGGQMQIWDJCW-BCPYKWEZSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C107H160N22O30 |
| Molecular Weight | 2234.50 g/mol |
| Exact Mass | 2234.1704266 g/mol |
| Topological Polar Surface Area (TPSA) | 787.00 Ų |
| XlogP | 3.50 |
| Atomic LogP (AlogP) | -4.91 |
| H-Bond Acceptor | 29 |
| H-Bond Donor | 26 |
| Rotatable Bonds | 47 |
| RefChem:185940 |
| (2S)-1-((2S)-2-(((2S,3S)-1-hydroxy-2-(((2S)-1-hydroxy-2-(((2S,3S)-1-hydroxy-2-(((2S)-1-hydroxy-2-(((2S)-1-hydroxy-2-((hydroxy-((2S)-1-((2S)-2-((1-hydroxy-2-(((2S)-1-hydroxy-2-(((2S,3S)-1-hydroxy-2-((hydroxy-((3S,6S,12S,15S,19S,22S,25S,28S)-5,8,11,14,17,21,24,27-octahydroxy-22-(2-hydroxy-2-iminoethyl)-3,6,15-tris(hydroxymethyl)-25-((4-hydroxyphenyl)methyl)-12-(2-methylpropyl)-2-oxo-1,4,7,10,13,16,20,23,26-nonazabicyclo(26.3.0)hentriaconta-4,7,10,13,16,20,23,26-octaen-19-yl)methylidene)amino)-3-methylpentylidene)amino)-4-methylpentylidene)amino)ethylidene)amino)-3-(4-hydroxyphenyl)propanoyl)pyrrolidin-2-yl)methylidene)amino)propylidene)amino)-4-methylpentylidene)amino)-3-methylpentylidene)amino)-3-methylbutylidene)amino)-3-methylpentylidene)amino)-3-(4-hydroxyphenyl)propanoyl)pyrrolidine-2-carboxylic acid |
| (2S)-1-((2S)-2-(((2S,3S)-2-(((2S)-2-(((2S,3S)-2-(((2S)-2-(((2S)-2-((((2S)-1-((2S)-2-((2-(((2S)-2-(((2S,3S)-2-((((3S,6S,9S,13S,16S,22S,25S,30as)-1,4,7,11,14,17,20,23-octahydroxy-6-((C-hydroxycarbonimidoyl)methyl)-13,22,25-tris(hydroxymethyl)-3-((4-hydroxyphenyl)methyl)-16-(2-methylpropyl)-26-oxo-3H,6H,9H,10H,13H,16H,19H,22H,25H,26H,28H,29H,30H,30ah-pyrrolo(2,1-i)1,4,7,10,13,16,19,22,25-nonaazacyclooctacosan-9-yl)(hydroxy)methylidene)amino)-1-hydroxy-3-methylpentylidene)amino)-1-hydroxy-4-methylpentylidene)amino)-1-hydroxyethylidene)amino)-3-(4-hydroxyphenyl)propanoyl)pyrrolidin-2-yl)(hydroxy)methylidene)amino)-1-hydroxypropylidene)amino)-1-hydroxy-4-methylpentylidene)amino)-1-hydroxy-3-methylpentylidene)amino)-1-hydroxy-3-methylbutylidene)amino)-1-hydroxy-3-methylpentylidene)amino)-3-(4-hydroxyphenyl)propanoyl)pyrrolidine-2-carboxylate |
| (2S)-1-((2S)-2-(((2S,3S)-2-(((2S)-2-(((2S,3S)-2-(((2S)-2-(((2S)-2-(((2S)-1-((2S)-2-((2-(((2S)-2-(((2S,3S)-2-(((3S,6S,12S,15S,19S,22S,25S,28S)-22-(2-amino-2-oxoethyl)-3,6,15-tris(hydroxymethyl)-25-((4-hydroxyphenyl)methyl)-12-(2-methylpropyl)-2,5,8,11,14,17,21,24,27-nonaoxo-1,4,7,10,13,16,20,23,26-nonazabicyclo(26.3.0)hentriacontane-19-carbonyl)amino)-3-methylpentanoyl)amino)-4-methylpentanoyl)amino)acetyl)amino)-3-(4-hydroxyphenyl)propanoyl)pyrrolidine-2-carbonyl)amino)propanoyl)amino)-4-methylpentanoyl)amino)-3-methylpentanoyl)amino)-3-methylbutanoyl)amino)-3-methylpentanoyl)amino)-3-(4-hydroxyphenyl)propanoyl)pyrrolidine-2-carboxylic acid |
| (2S)-1-[(2S)-2-[[(2S,3S)-1-hydroxy-2-[[(2S)-1-hydroxy-2-[[(2S,3S)-1-hydroxy-2-[[(2S)-1-hydroxy-2-[[(2S)-1-hydroxy-2-[[hydroxy-[(2S)-1-[(2S)-2-[[1-hydroxy-2-[[(2S)-1-hydroxy-2-[[(2S,3S)-1-hydroxy-2-[[hydroxy-[(3S,6S,12S,15S,19S,22S,25S,28S)-5,8,11,14,17,21,24,27-octahydroxy-22-(2-hydroxy-2-iminoethyl)-3,6,15-tris(hydroxymethyl)-25-[(4-hydroxyphenyl)methyl]-12-(2-methylpropyl)-2-oxo-1,4,7,10,13,16,20,23,26-nonazabicyclo[26.3.0]hentriaconta-4,7,10,13,16,20,23,26-octaen-19-yl]methylidene]amino]-3-methylpentylidene]amino]-4-methylpentylidene]amino]ethylidene]amino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidin-2-yl]methylidene]amino]propylidene]amino]-4-methylpentylidene]amino]-3-methylpentylidene]amino]-3-methylbutylidene]amino]-3-methylpentylidene]amino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carboxylic acid |
| (2S)-1-[(2S)-2-[[(2S,3S)-2-[[(2S)-2-[[(2S,3S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-1-[(2S)-2-[[2-[[(2S)-2-[[(2S,3S)-2-[[(3S,6S,12S,15S,19S,22S,25S,28S)-22-(2-amino-2-oxoethyl)-3,6,15-tris(hydroxymethyl)-25-[(4-hydroxyphenyl)methyl]-12-(2-methylpropyl)-2,5,8,11,14,17,21,24,27-nonaoxo-1,4,7,10,13,16,20,23,26-nonazabicyclo[26.3.0]hentriacontane-19-carbonyl]amino]-3-methylpentanoyl]amino]-4-methylpentanoyl]amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]propanoyl]amino]-4-methylpentanoyl]amino]-3-methylpentanoyl]amino]-3-methylbutanoyl]amino]-3-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carboxylic acid |
| (2S)-1-[(2S)-2-{[(2S,3S)-2-{[(2S)-2-{[(2S,3S)-2-{[(2S)-2-{[(2S)-2-({[(2S)-1-[(2S)-2-[(2-{[(2S)-2-{[(2S,3S)-2-({[(3S,6S,9S,13S,16S,22S,25S,30as)-1,4,7,11,14,17,20,23-octahydroxy-6-[(C-hydroxycarbonimidoyl)methyl]-13,22,25-tris(hydroxymethyl)-3-[(4-hydroxyphenyl)methyl]-16-(2-methylpropyl)-26-oxo-3H,6H,9H,10H,13H,16H,19H,22H,25H,26H,28H,29H,30H,30ah-pyrrolo[2,1-i]1,4,7,10,13,16,19,22,25-nonaazacyclooctacosan-9-yl](hydroxy)methylidene}amino)-1-hydroxy-3-methylpentylidene]amino}-1-hydroxy-4-methylpentylidene]amino}-1-hydroxyethylidene)amino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidin-2-yl](hydroxy)methylidene}amino)-1-hydroxypropylidene]amino}-1-hydroxy-4-methylpentylidene]amino}-1-hydroxy-3-methylpentylidene]amino}-1-hydroxy-3-methylbutylidene]amino}-1-hydroxy-3-methylpentylidene]amino}-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carboxylate |
| SCHEMBL29471775 |
| CHEBI:200727 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8648 | 86.48% |
| Caco-2 | - | 0.8603 | 86.03% |
| Blood Brain Barrier | - | 0.9750 | 97.50% |
| Human oral bioavailability | - | 0.6571 | 65.71% |
| Subcellular localzation | Mitochondria | 0.4311 | 43.11% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8201 | 82.01% |
| OATP1B3 inhibitior | + | 0.9337 | 93.37% |
| MATE1 inhibitior | - | 0.9200 | 92.00% |
| OCT2 inhibitior | - | 0.7500 | 75.00% |
| BSEP inhibitior | + | 0.9728 | 97.28% |
| P-glycoprotein inhibitior | + | 0.7417 | 74.17% |
| P-glycoprotein substrate | + | 0.8854 | 88.54% |
| CYP3A4 substrate | + | 0.7523 | 75.23% |
| CYP2C9 substrate | + | 0.6095 | 60.95% |
| CYP2D6 substrate | - | 0.8359 | 83.59% |
| CYP3A4 inhibition | - | 0.8136 | 81.36% |
| CYP2C9 inhibition | - | 0.9073 | 90.73% |
| CYP2C19 inhibition | - | 0.8779 | 87.79% |
| CYP2D6 inhibition | - | 0.8779 | 87.79% |
| CYP1A2 inhibition | - | 0.9443 | 94.43% |
| CYP2C8 inhibition | + | 0.8221 | 82.21% |
| CYP inhibitory promiscuity | - | 0.9392 | 93.92% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.8300 | 83.00% |
| Carcinogenicity (trinary) | Non-required | 0.6133 | 61.33% |
| Eye corrosion | - | 0.9895 | 98.95% |
| Eye irritation | - | 0.8953 | 89.53% |
| Skin irritation | - | 0.7957 | 79.57% |
| Skin corrosion | - | 0.9340 | 93.40% |
| Ames mutagenesis | - | 0.7100 | 71.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7190 | 71.90% |
| Micronuclear | + | 0.8500 | 85.00% |
| Hepatotoxicity | + | 0.5125 | 51.25% |
| skin sensitisation | - | 0.8982 | 89.82% |
| Respiratory toxicity | + | 0.7889 | 78.89% |
| Reproductive toxicity | + | 0.9889 | 98.89% |
| Mitochondrial toxicity | + | 0.8750 | 87.50% |
| Nephrotoxicity | + | 0.7325 | 73.25% |
| Acute Oral Toxicity (c) | III | 0.4901 | 49.01% |
| Estrogen receptor binding | - | 0.5236 | 52.36% |
| Androgen receptor binding | + | 0.7461 | 74.61% |
| Thyroid receptor binding | + | 0.7532 | 75.32% |
| Glucocorticoid receptor binding | + | 0.8286 | 82.86% |
| Aromatase binding | + | 0.7946 | 79.46% |
| PPAR gamma | + | 0.7661 | 76.61% |
| Honey bee toxicity | - | 0.6609 | 66.09% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | - | 0.5600 | 56.00% |
| Fish aquatic toxicity | + | 0.9082 | 90.82% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 100.00% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.83% | 96.61% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.64% | 83.82% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.07% | 97.64% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 98.99% | 97.23% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.81% | 94.45% |
| CHEMBL236 | P41143 | Delta opioid receptor | 98.78% | 99.35% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 98.59% | 82.38% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 98.43% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.29% | 96.09% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 97.24% | 98.94% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 96.76% | 97.14% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 96.74% | 96.67% |
| CHEMBL4461 | Q9NTG7 | NAD-dependent deacetylase sirtuin 3 | 96.57% | 94.36% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 96.33% | 93.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.31% | 97.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 95.98% | 89.63% |
| CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 95.94% | 96.69% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 95.93% | 100.00% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 95.79% | 83.14% |
| CHEMBL227 | P30556 | Type-1 angiotensin II receptor | 95.31% | 99.53% |
| CHEMBL1801 | P00747 | Plasminogen | 95.15% | 92.44% |
| CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 95.11% | 99.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 95.07% | 90.71% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.81% | 91.11% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 94.41% | 95.00% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 94.31% | 96.67% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 94.11% | 94.66% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 93.61% | 90.08% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 93.58% | 98.24% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 93.43% | 97.64% |
| CHEMBL4801 | P29466 | Caspase-1 | 92.94% | 96.85% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.92% | 93.56% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 92.49% | 90.24% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 92.48% | 90.93% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 92.19% | 97.43% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 91.97% | 98.33% |
| CHEMBL204 | P00734 | Thrombin | 91.75% | 96.01% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.71% | 91.19% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.22% | 96.90% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.54% | 95.89% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 90.11% | 88.42% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.78% | 99.17% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 89.36% | 96.11% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.04% | 95.89% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 88.60% | 98.89% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 88.53% | 96.03% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.84% | 95.56% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 87.37% | 89.33% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 87.27% | 92.97% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 86.71% | 98.05% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.64% | 90.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.06% | 95.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.85% | 89.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.82% | 100.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 84.71% | 93.10% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 83.98% | 92.80% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.87% | 91.03% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.68% | 100.00% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 83.39% | 96.67% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.36% | 90.20% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.63% | 98.75% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.34% | 82.69% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.14% | 96.47% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.89% | 85.00% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 81.74% | 82.50% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.67% | 95.83% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.37% | 95.38% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.19% | 95.50% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 80.87% | 99.18% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 80.77% | 94.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.22% | 97.25% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 80.21% | 96.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139584119 |
| LOTUS | LTS0276282 |
| wikiData | Q77279855 |