Streptoglutarimide H
| Internal ID | 70c8879b-9c61-4aec-8234-823fe336e8bc |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Hydropyridines > Tetrahydropyridines |
| IUPAC Name | 4-[(2R)-2-hydroxy-2-[(1S,3S,4R,5R)-4-hydroxy-3,5-dimethyl-2-oxocyclohexyl]ethyl]piperidine-2,6-dione |
| SMILES (Canonical) | CC1CC(C(=O)C(C1O)C)C(CC2CC(=O)NC(=O)C2)O |
| SMILES (Isomeric) | C[C@@H]1C[C@H](C(=O)[C@H]([C@@H]1O)C)[C@@H](CC2CC(=O)NC(=O)C2)O |
| InChI | InChI=1S/C15H23NO5/c1-7-3-10(15(21)8(2)14(7)20)11(17)4-9-5-12(18)16-13(19)6-9/h7-11,14,17,20H,3-6H2,1-2H3,(H,16,18,19)/t7-,8+,10+,11-,14-/m1/s1 |
| InChI Key | JZQFWTNEUBVJCY-JDMXSVICSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.15762283 g/mol |
| Topological Polar Surface Area (TPSA) | 104.00 Ų |
| XlogP | -0.40 |
| 4-[(2R)-2-hydroxy-2-[(1S,3S,4R,5R)-4-hydroxy-3,5-dimethyl-2-oxocyclohexyl]ethyl]piperidine-2,6-dione |
| 4-((2R)-2-hydroxy-2-((1S,3S,4R,5R)-4-hydroxy-3,5-dimethyl-2-oxocyclohexyl)ethyl)piperidine-2,6-dione |
| RefChem:185923 |
| CHEMBL4556971 |
| CHEBI:225559 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.57% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.56% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.52% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.17% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.38% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.40% | 97.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.34% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.01% | 95.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.45% | 100.00% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 84.51% | 98.03% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.83% | 90.08% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.57% | 96.61% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.73% | 95.89% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 80.42% | 98.59% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 145721258 |
| LOTUS | LTS0205965 |
| wikiData | Q105137511 |