Streptocidin R
| Internal ID | 066a8362-69dd-4955-b65a-6fd3ac084ddd |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | 3-[9-(4-aminobutyl)-21-(2-amino-2-oxoethyl)-3-benzyl-15-[(4-hydroxyphenyl)methyl]-24-(1H-indol-3-ylmethyl)-6,27-bis(2-methylpropyl)-2,5,8,11,14,17,20,23,26,29-decaoxo-12-propan-2-yl-1,4,7,10,13,16,19,22,25,28-decazabicyclo[28.3.0]tritriacontan-18-yl]propanamide |
| SMILES (Canonical) | CC(C)CC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N2CCCC2C(=O)N1)CC3=CC=CC=C3)CC(C)C)CCCCN)C(C)C)CC4=CC=C(C=C4)O)CCC(=O)N)CC(=O)N)CC5=CNC6=CC=CC=C65 |
| SMILES (Isomeric) | CC(C)CC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N2CCCC2C(=O)N1)CC3=CC=CC=C3)CC(C)C)CCCCN)C(C)C)CC4=CC=C(C=C4)O)CCC(=O)N)CC(=O)N)CC5=CNC6=CC=CC=C65 |
| InChI | InChI=1S/C66H92N14O13/c1-36(2)29-47-60(87)78-52(32-39-15-8-7-9-16-39)66(93)80-28-14-20-53(80)64(91)77-48(30-37(3)4)59(86)75-50(33-41-35-70-44-18-11-10-17-43(41)44)61(88)76-51(34-55(69)83)62(89)71-46(25-26-54(68)82)58(85)74-49(31-40-21-23-42(81)24-22-40)63(90)79-56(38(5)6)65(92)72-45(57(84)73-47)19-12-13-27-67/h7-11,15-18,21-24,35-38,45-53,56,70,81H,12-14,19-20,25-34,67H2,1-6H3,(H2,68,82)(H2,69,83)(H,71,89)(H,72,92)(H,73,84)(H,74,85)(H,75,86)(H,76,88)(H,77,91)(H,78,87)(H,79,90) |
| InChI Key | KLGUDDOVDXKDML-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C66H92N14O13 |
| Molecular Weight | 1289.50 g/mol |
| Exact Mass | 1288.69682904 g/mol |
| Topological Polar Surface Area (TPSA) | 430.00 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.89% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.62% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.30% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.36% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.91% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.33% | 94.45% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 96.24% | 97.64% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.95% | 90.08% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.89% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.54% | 97.09% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 94.26% | 96.25% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 94.03% | 82.38% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 92.28% | 88.56% |
| CHEMBL1293287 | P14735 | Insulin-degrading enzyme | 90.05% | 88.10% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 88.76% | 96.11% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 88.42% | 90.71% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.92% | 91.71% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.90% | 96.47% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 87.74% | 92.97% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.51% | 83.82% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 86.99% | 95.00% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 86.21% | 95.56% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 84.47% | 95.62% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.24% | 99.17% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 84.17% | 99.18% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 83.40% | 92.32% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 82.90% | 96.31% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.84% | 94.62% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.72% | 85.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.21% | 82.69% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.06% | 94.75% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.34% | 83.10% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.23% | 95.50% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.06% | 97.05% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 80.43% | 97.79% |
| CHEMBL3837 | P07711 | Cathepsin L | 80.04% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146684625 |
| LOTUS | LTS0222487 |
| wikiData | Q105142613 |