Streptcytosine G
| Internal ID | 7b5b2e53-42a4-4d33-8481-afbc5cee8f66 |
| Taxonomy | Organoheterocyclic compounds > Diazines > Pyrimidines and pyrimidine derivatives > Hydroxypyrimidines |
| IUPAC Name | N-[1-[(2R,4R,5S,6R)-4,5-dihydroxy-6-methyloxan-2-yl]-2-oxopyrimidin-4-yl]-3-methylbut-2-enamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H21N3O5/c1-8(2)6-12(20)16-11-4-5-18(15(22)17-11)13-7-10(19)14(21)9(3)23-13/h4-6,9-10,13-14,19,21H,7H2,1-3H3,(H,16,17,20,22)/t9-,10-,13-,14-/m1/s1 |
| InChI Key | TYKNEQGBFJLSFS-DMTCVQMQSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14812078 g/mol |
| Topological Polar Surface Area (TPSA) | 111.00 Ų |
| XlogP | 0.30 |
| CHEMBL4466057 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.32% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.30% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.65% | 99.23% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.36% | 90.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.00% | 89.00% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 89.53% | 81.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.96% | 86.33% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.18% | 91.49% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.10% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.53% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.81% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.72% | 94.45% |
| CHEMBL1859 | O95180 | Voltage-gated T-type calcium channel alpha-1H subunit | 82.27% | 98.57% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 81.49% | 96.39% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.34% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 145721208 |
| LOTUS | LTS0036744 |
| wikiData | Q105267382 |