Sternbin
Internal ID | 2fd19538-aac0-453b-9fea-c9f78bbf0b74 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=CC(=C2C(=O)CC(OC2=C1)C3=CC(=C(C=C3)O)O)O |
SMILES (Isomeric) | COC1=CC(=C2C(=O)CC(OC2=C1)C3=CC(=C(C=C3)O)O)O |
InChI | InChI=1S/C16H14O6/c1-21-9-5-12(19)16-13(20)7-14(22-15(16)6-9)8-2-3-10(17)11(18)4-8/h2-6,14,17-19H,7H2,1H3 |
InChI Key | DSAJORLEPQBKDA-UHFFFAOYSA-N |
Popularity | 9 references in papers |
Molecular Formula | C16H14O6 |
Molecular Weight | 302.28 g/mol |
Exact Mass | 302.07903816 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 2.40 |
2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-2,3-dihydrochromen-4-one |
MEGxp0_000573 |
SCHEMBL2306531 |
CHEMBL3233849 |
7-Methyleriodictyol; 7-O-Methyleriodictyol; Eriodictyol 7-methyl ether; Sternbin |
BCA85711 |
LMPK12140580 |
5,3',4'-trihydroxy-7-methoxy flavanone |
FT-0777976 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.25% | 91.11% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.25% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.90% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.57% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.10% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.91% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.29% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.65% | 90.00% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 90.31% | 92.68% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.58% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 87.55% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.71% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.61% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.27% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.35% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.43% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 4872981 |
LOTUS | LTS0118210 |
wikiData | Q104987737 |