Stellettin I
| Internal ID | cec98b8e-ba2a-4e8a-83b7-573fbf0c01e0 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | (2E,4E,6E,8E,10Z)-10-[(3aS,5aS,7S,9aS,9bS)-7-methoxycarbonyl-3a,6,6,9a-tetramethyl-2-oxo-1,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalen-3-ylidene]-2,6-dimethylundeca-2,4,6,8-tetraenoic acid |
| SMILES (Canonical) | CC(=CC=CC(=C1C(=O)CC2C1(CCC3C2(CCC(C3(C)C)C(=O)OC)C)C)C)C=CC=C(C)C(=O)O |
| SMILES (Isomeric) | C/C(=C\C=C\C(=C\1/C(=O)C[C@@H]2[C@@]1(CC[C@@H]3[C@@]2(CC[C@@H](C3(C)C)C(=O)OC)C)C)\C)/C=C/C=C(\C)/C(=O)O |
| InChI | InChI=1S/C32H44O5/c1-20(12-10-14-22(3)28(34)35)11-9-13-21(2)27-24(33)19-26-31(6)17-15-23(29(36)37-8)30(4,5)25(31)16-18-32(26,27)7/h9-14,23,25-26H,15-19H2,1-8H3,(H,34,35)/b12-10+,13-9+,20-11+,22-14+,27-21+/t23-,25+,26+,31+,32+/m1/s1 |
| InChI Key | AZCFRDBOFGFKPT-WKNBVIIXSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C32H44O5 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.31887450 g/mol |
| Topological Polar Surface Area (TPSA) | 80.70 Ų |
| XlogP | 8.10 |
| RefChem:185479 |
| (2E,4E,6E,8E,10Z)-10-((3aS,5aS,7S,9aS,9bS)-7-methoxycarbonyl-3a,6,6,9a-tetramethyl-2-oxo-1,4,5,5a,7,8,9,9b-octahydrocyclopenta(a)naphthalen-3-ylidene)-2,6-dimethylundeca-2,4,6,8-tetraenoic acid |
| 405202-90-6 |
| CHEMBL457369 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.51% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.55% | 90.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.96% | 91.19% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.20% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.68% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.44% | 94.45% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.17% | 82.69% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 85.25% | 85.30% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.89% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.22% | 99.23% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 82.86% | 98.10% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.75% | 95.89% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.35% | 93.00% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.01% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 44584141 |
| LOTUS | LTS0083768 |
| wikiData | Q104921609 |