Stachartone A
| Internal ID | c65e1056-5a09-4507-9d1b-2b1dea11243b |
| Taxonomy | Lignans, neolignans and related compounds |
| IUPAC Name | (3R,4aS,7R,7'R,8R,8'R,8aS)-7'-[(3R,7R,8R,8aS)-3,4'-dihydroxy-6'-(hydroxymethyl)-4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-3H-1-benzofuran]-7'-yl]-3,4',8'-trihydroxy-4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-7,8-dihydro-3H-cyclopenta[g][1]benzofuran]-6'-one |
| SMILES (Canonical) | CC1CCC2C(C(CCC2(C13CC4=C(C=C(C(=C4O3)C5C(C6=C7C(=C(C=C6C5=O)O)CC8(O7)C(CCC9C8(CCC(C9(C)C)O)C)C)O)CO)O)C)O)(C)C |
| SMILES (Isomeric) | C[C@@H]1CC[C@@H]2[C@@]([C@@]13CC4=C(C=C5C(=O)[C@@H]([C@H](C5=C4O3)O)C6=C7C(=C(C=C6CO)O)C[C@@]8(O7)[C@@H](CCC9[C@@]8(CC[C@H](C9(C)C)O)C)C)O)(CC[C@H](C2(C)C)O)C |
| InChI | InChI=1S/C46H62O9/c1-22-9-11-30-41(3,4)32(50)13-15-43(30,7)45(22)19-26-28(48)17-24(21-47)34(39(26)54-45)36-37(52)25-18-29(49)27-20-46(55-40(27)35(25)38(36)53)23(2)10-12-31-42(5,6)33(51)14-16-44(31,46)8/h17-18,22-23,30-33,36,38,47-51,53H,9-16,19-21H2,1-8H3/t22-,23-,30?,31+,32-,33-,36+,38+,43+,44+,45-,46-/m1/s1 |
| InChI Key | HRXKKENEEGSHKS-CQKBCQEJSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C46H62O9 |
| Molecular Weight | 759.00 g/mol |
| Exact Mass | 758.43938355 g/mol |
| Topological Polar Surface Area (TPSA) | 157.00 Ų |
| XlogP | 7.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.13% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.59% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.92% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.12% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.06% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.41% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.39% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.67% | 94.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.26% | 90.71% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.90% | 92.62% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.89% | 93.40% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.35% | 92.94% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.05% | 97.25% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.26% | 95.89% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.10% | 93.99% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.45% | 97.28% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.20% | 86.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139591709 |
| LOTUS | LTS0225648 |
| wikiData | Q105032880 |