Squamocin F
Internal ID | 118aa2e7-e973-41e1-a7a5-6f02590cbe0b |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols > Annonaceous acetogenins |
IUPAC Name | 4-[10,13-dihydroxy-13-[5-[5-(1-hydroxyundecyl)oxolan-2-yl]oxolan-2-yl]tridecyl]-2-methyl-2H-furan-5-one |
SMILES (Canonical) | CCCCCCCCCCC(C1CCC(O1)C2CCC(O2)C(CCC(CCCCCCCCCC3=CC(OC3=O)C)O)O)O |
SMILES (Isomeric) | CCCCCCCCCCC(C1CCC(O1)C2CCC(O2)C(CCC(CCCCCCCCCC3=CC(OC3=O)C)O)O)O |
InChI | InChI=1S/C37H66O7/c1-3-4-5-6-7-11-14-17-20-31(39)33-23-25-35(43-33)36-26-24-34(44-36)32(40)22-21-30(38)19-16-13-10-8-9-12-15-18-29-27-28(2)42-37(29)41/h27-28,30-36,38-40H,3-26H2,1-2H3 |
InChI Key | OMAAXGPFIAQGDB-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C37H66O7 |
Molecular Weight | 622.90 g/mol |
Exact Mass | 622.48085444 g/mol |
Topological Polar Surface Area (TPSA) | 105.00 Ų |
XlogP | 9.70 |
DTXSID301108759 |
159957-81-0 |
2(5H)-Furanone, 3-[10,13-dihydroxy-13-[octahydro-5'-(1-hydroxyundecyl)[2,2'-bifuran]-5-yl]tridecyl]-5-methyl- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.32% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.33% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.59% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.36% | 91.11% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 92.82% | 85.94% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.11% | 94.73% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 90.91% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.70% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.37% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.80% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.38% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.73% | 97.09% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.61% | 97.29% |
CHEMBL1907 | P15144 | Aminopeptidase N | 82.47% | 93.31% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 81.97% | 97.79% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.54% | 93.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.41% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.50% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Annona squamosa |
PubChem | 85130822 |
LOTUS | LTS0196842 |
wikiData | Q105194221 |