Spongioside A
Internal ID | 32b0cb1a-0e51-4922-87d7-e84f58fe3f55 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | (2S,3R,5R)-2-[(3S,4S,6R)-4-hydroxy-2-(hydroxymethyl)-6-[[(3S,8S,9S,10R,13S,14S,16S,17R)-17-[(2S,3S)-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-16-[(2R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-5-[(2S,3S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)OC3C(C(C(C(O3)C)O)O)O)OC4CCC5(C6CCC7(C(C6CC=C5C4)CC(C7C(C)C(CCC(C)C)O)OC8C(C(C(C(O8)CO)O)O)O)C)C)CO)O)O)O |
SMILES (Isomeric) | CC1[C@@H](C([C@H]([C@@H](O1)O[C@H]2[C@@H](C([C@@H](OC2CO)O[C@H]3CC[C@@]4([C@H]5CC[C@]6([C@H]([C@@H]5CC=C4C3)C[C@@H]([C@@H]6[C@H](C)[C@H](CCC(C)C)O)O[C@H]7C([C@H]([C@@H](C(O7)CO)O)O)O)C)C)O[C@H]8[C@H](C([C@H](C(O8)C)O)O)O)O)O)O)O |
InChI | InChI=1S/C51H86O21/c1-20(2)8-11-29(54)21(3)33-30(68-48-42(63)39(60)36(57)31(18-52)69-48)17-28-26-10-9-24-16-25(12-14-50(24,6)27(26)13-15-51(28,33)7)67-49-45(72-47-41(62)38(59)35(56)23(5)66-47)43(64)44(32(19-53)70-49)71-46-40(61)37(58)34(55)22(4)65-46/h9,20-23,25-49,52-64H,8,10-19H2,1-7H3/t21-,22?,23?,25+,26-,27+,28+,29+,30+,31?,32?,33+,34+,35+,36-,37?,38?,39+,40-,41+,42?,43+,44-,45?,46+,47+,48-,49-,50+,51+/m1/s1 |
InChI Key | CMVKGKGHOKTWFO-AGMTUBSVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C51H86O21 |
Molecular Weight | 1035.20 g/mol |
Exact Mass | 1034.56615975 g/mol |
Topological Polar Surface Area (TPSA) | 337.00 Ų |
XlogP | -0.30 |
3-O-(Rhaa1-4(Rhaa1-2)Glcb)-16-O-(Glcb)-cholest-5-en-3beta,16beta,22S-triol |
(22S)-16beta-[(beta-D-glucopyranosyl)oxy]-22-hydroxycholest-5-en-3beta-yl O-alpha-L-rhamnopyranosyl-(1-2)-O-[alpha-L-rhamnopyranosyl-(1-4)]-beta-D-glucopyranoside |
LMST01010343 |
![2D Structure of Spongioside A 2D Structure of Spongioside A](https://plantaedb.com/storage/docs/compounds/2023/11/spongioside-a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.22% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 99.14% | 95.93% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.70% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.39% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 95.14% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.64% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 93.99% | 95.89% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 91.82% | 98.05% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.96% | 97.36% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.79% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.76% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.47% | 93.56% |
CHEMBL237 | P41145 | Kappa opioid receptor | 89.37% | 98.10% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.25% | 85.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.11% | 95.89% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 88.02% | 94.50% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 87.92% | 95.58% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.73% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.00% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.42% | 86.33% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 85.35% | 97.29% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 84.80% | 89.05% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.36% | 97.33% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 84.13% | 97.79% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.21% | 90.08% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.31% | 94.73% |
CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 82.05% | 97.56% |
CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 81.98% | 96.31% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.77% | 100.00% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 80.92% | 89.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dioscorea spongiosa |
PubChem | 52931347 |
LOTUS | LTS0130737 |
wikiData | Q104388872 |