Spongidepsin
| Internal ID | 9c60811c-5e96-497e-96a5-794d66f09e1d |
| Taxonomy | Phenylpropanoids and polyketides > Macrolide lactams |
| IUPAC Name | (3S,6S,8S)-3-benzyl-4,6,8,11-tetramethyl-13-pent-4-ynyl-1-oxa-4-azacyclotridecane-2,5-dione |
| SMILES (Canonical) | CC1CCC(CC(OC(=O)C(N(C(=O)C(C1)C)C)CC2=CC=CC=C2)CCCC#C)C |
| SMILES (Isomeric) | C[C@H]1CCC(CC(OC(=O)[C@@H](N(C(=O)[C@H](C1)C)C)CC2=CC=CC=C2)CCCC#C)C |
| InChI | InChI=1S/C27H39NO3/c1-6-7-9-14-24-18-21(3)16-15-20(2)17-22(4)26(29)28(5)25(27(30)31-24)19-23-12-10-8-11-13-23/h1,8,10-13,20-22,24-25H,7,9,14-19H2,2-5H3/t20-,21?,22-,24?,25-/m0/s1 |
| InChI Key | POCWPUILAAGBLK-AZQWGEHQSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C27H39NO3 |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.29299411 g/mol |
| Topological Polar Surface Area (TPSA) | 46.60 Ų |
| XlogP | 6.70 |
| (3S,6S,8S)-3-benzyl-4,6,8,11-tetramethyl-13-pent-4-ynyl-1-oxa-4-azacyclotridecane-2,5-dione |
| RefChem:185004 |
| (3S,6R,8R,11R,13R)-3-benzyl-4,6,8,11-tetramethyl-13-pent-4-ynyl-1-oxa-4-azacyclotridecane-2,5-dione |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.64% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.76% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.23% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.66% | 91.49% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 93.26% | 91.76% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.77% | 86.33% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.28% | 93.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.17% | 85.14% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 89.02% | 96.25% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.86% | 90.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.44% | 95.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.11% | 99.23% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 81.73% | 92.97% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.49% | 82.38% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.14% | 95.89% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.12% | 98.33% |
| CHEMBL4072 | P07858 | Cathepsin B | 81.09% | 93.67% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 81.06% | 97.64% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 80.63% | 92.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11058999 |
| LOTUS | LTS0160516 |
| wikiData | Q105212347 |