Spiro[4.5]dec-8-en-7-ol, 1,8-dimethyl-4-(1-methylethyl)-
| Internal ID | 63312712-d34c-4800-aa52-d4745c97a33b |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Secondary alcohols |
| IUPAC Name | 1,8-dimethyl-4-propan-2-ylspiro[4.5]dec-7-en-9-ol |
| SMILES (Canonical) | CC1CCC(C12CC=C(C(C2)O)C)C(C)C |
| SMILES (Isomeric) | CC1CCC(C12CC=C(C(C2)O)C)C(C)C |
| InChI | InChI=1S/C15H26O/c1-10(2)13-6-5-12(4)15(13)8-7-11(3)14(16)9-15/h7,10,12-14,16H,5-6,8-9H2,1-4H3 |
| InChI Key | WBVRKDUUNZBZET-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.198365449 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 3.90 |
| Spiro[4.5]dec-8-en-7-ol, 1,8-dimethyl-4-(1-methylethyl)- |
| DTXSID40343766 |
| WBVRKDUUNZBZET-UHFFFAOYSA-N |
| 1-Isopropyl-4,8-dimethylspiro[4.5]dec-8-en-7-ol # |
| Spiro[4.5]dec-8-en-7-ol, 4,8-dimethyl-1-(1-methylethyl)- |
![2D Structure of Spiro[4.5]dec-8-en-7-ol, 1,8-dimethyl-4-(1-methylethyl)-](https://plantaedb.com/storage/docs/compounds/2023/11/spiro45dec-8-en-7-ol-18-dimethyl-4-1-methylethyl-.jpg "2D Structure of Spiro[4.5]dec-8-en-7-ol, 1,8-dimethyl-4-(1-methylethyl)-")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.74% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.80% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.53% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.14% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.80% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.08% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.41% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.28% | 90.71% |
| CHEMBL4444 | P04070 | Vitamin K-dependent protein C | 82.15% | 93.89% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.64% | 96.38% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 81.51% | 86.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.38% | 93.56% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.62% | 95.89% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.48% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 592066 |
| LOTUS | LTS0089173 |
| wikiData | Q82115259 |