Spinatoside
Internal ID | 8b7e768c-073e-4821-93cc-c7f4e7689f7c |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glucuronides |
IUPAC Name | (2S,3S,4S,5R,6S)-6-[4-(5,7-dihydroxy-3,6-dimethoxy-4-oxochromen-2-yl)-2-hydroxyphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | COC1=C(C2=C(C=C1O)OC(=C(C2=O)OC)C3=CC(=C(C=C3)OC4C(C(C(C(O4)C(=O)O)O)O)O)O)O |
SMILES (Isomeric) | COC1=C(C2=C(C=C1O)OC(=C(C2=O)OC)C3=CC(=C(C=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C(=O)O)O)O)O)O)O |
InChI | InChI=1S/C23H22O14/c1-33-19-9(25)6-11-12(13(19)26)14(27)20(34-2)18(35-11)7-3-4-10(8(24)5-7)36-23-17(30)15(28)16(29)21(37-23)22(31)32/h3-6,15-17,21,23-26,28-30H,1-2H3,(H,31,32)/t15-,16-,17+,21-,23+/m0/s1 |
InChI Key | YIDAQAJEKNRLJS-QJAHINBCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H22O14 |
Molecular Weight | 522.40 g/mol |
Exact Mass | 522.10095537 g/mol |
Topological Polar Surface Area (TPSA) | 222.00 Ų |
XlogP | 0.90 |
Axillarin 4'-glucuronide |
65039-74-9 |
(2S,3S,4S,5R,6S)-6-[4-(5,7-dihydroxy-3,6-dimethoxy-4-oxochromen-2-yl)-2-hydroxyphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
beta-D-Glucopyranosiduronic acid, 4-(5,7-dihydroxy-3,6-dimethoxy-4-oxo-4H-1-benzopyran-2-yl)-2-hydroxyphenyl |
CHEBI:169144 |
DTXSID001318230 |
AKOS040734588 |
(2S,3S,4S,5R,6S)-6-[4-(5,7-dihydroxy-3,6-dimethoxy-4-oxo-4H-chromen-2-yl)-2-hydroxyphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.00% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.91% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.00% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.76% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 93.48% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.29% | 94.45% |
CHEMBL3194 | P02766 | Transthyretin | 91.43% | 90.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 90.87% | 95.64% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.82% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.47% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.70% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.35% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.43% | 99.15% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 83.59% | 87.67% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.20% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.81% | 96.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 81.95% | 83.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.70% | 95.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.05% | 99.23% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.07% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Spinacia oleracea |
PubChem | 21722022 |
LOTUS | LTS0157833 |
wikiData | Q76512104 |