Spicatanol
Internal ID | 5019d04c-62a7-4adb-9f31-cecf651447e7 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
IUPAC Name | (2R)-3-[(E)-2-[(1S,4aS,8aR)-2,5,5,8a-tetramethyl-4-oxo-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl]ethenyl]-2-hydroxy-2H-furan-5-one |
SMILES (Canonical) | CC1=CC(=O)C2C(CCCC2(C1C=CC3=CC(=O)OC3O)C)(C)C |
SMILES (Isomeric) | CC1=CC(=O)[C@@H]2[C@@]([C@H]1/C=C/C3=CC(=O)O[C@H]3O)(CCCC2(C)C)C |
InChI | InChI=1S/C20H26O4/c1-12-10-15(21)17-19(2,3)8-5-9-20(17,4)14(12)7-6-13-11-16(22)24-18(13)23/h6-7,10-11,14,17-18,23H,5,8-9H2,1-4H3/b7-6+/t14-,17-,18+,20+/m0/s1 |
InChI Key | KJASBNIUXGTDRP-GDJISRORSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H26O4 |
Molecular Weight | 330.40 g/mol |
Exact Mass | 330.18310931 g/mol |
Topological Polar Surface Area (TPSA) | 63.60 Ų |
XlogP | 3.10 |
CHEMBL467675 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.08% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.88% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.27% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.35% | 89.00% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 86.17% | 86.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.11% | 94.75% |
CHEMBL2581 | P07339 | Cathepsin D | 85.52% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.33% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.35% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.76% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.71% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.08% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.05% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hedychium spicatum |
PubChem | 42630816 |
NPASS | NPC242069 |
ChEMBL | CHEMBL467675 |
LOTUS | LTS0228057 |
wikiData | Q105141759 |