sophoronol B
Internal ID | b1d637df-270f-49b2-8852-65f02cd9ece7 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanones > 3-prenylated isoflavanones |
IUPAC Name | (3S)-3,5,7-trihydroxy-3-[2-(hydroxymethyl)-5-methoxy-2-methylchromen-6-yl]-2H-chromen-4-one |
SMILES (Canonical) | CC1(C=CC2=C(O1)C=CC(=C2OC)C3(COC4=CC(=CC(=C4C3=O)O)O)O)CO |
SMILES (Isomeric) | CC1(C=CC2=C(O1)C=CC(=C2OC)[C@@]3(COC4=CC(=CC(=C4C3=O)O)O)O)CO |
InChI | InChI=1S/C21H20O8/c1-20(9-22)6-5-12-15(29-20)4-3-13(18(12)27-2)21(26)10-28-16-8-11(23)7-14(24)17(16)19(21)25/h3-8,22-24,26H,9-10H2,1-2H3/t20?,21-/m1/s1 |
InChI Key | XVFVOIOTKHNXRQ-BPGUCPLFSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H20O8 |
Molecular Weight | 400.40 g/mol |
Exact Mass | 400.11581759 g/mol |
Topological Polar Surface Area (TPSA) | 126.00 Ų |
XlogP | 2.00 |
CHEMBL552109 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.54% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.66% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 95.39% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.99% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.75% | 96.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.73% | 93.99% |
CHEMBL4208 | P20618 | Proteasome component C5 | 93.21% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.31% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.69% | 89.00% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 87.58% | 96.12% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.39% | 94.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.13% | 94.80% |
CHEMBL240 | Q12809 | HERG | 86.56% | 89.76% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.94% | 92.62% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.64% | 94.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.21% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.12% | 99.15% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.50% | 96.77% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.32% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.47% | 91.07% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.00% | 99.23% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 81.90% | 97.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.53% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sophora mollis |
PubChem | 44233683 |
LOTUS | LTS0123983 |
wikiData | Q105342855 |