Sophoranol-N-oxy
| Internal ID | 9afff0aa-ac60-4a2b-80d0-87fda283e1ba |
| Taxonomy | Alkaloids and derivatives > Lupin alkaloids > Matrine alkaloids |
| IUPAC Name | 9-hydroxy-13-oxido-7-aza-13-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
| SMILES (Canonical) | C1CC2C3CCC[N+]4(C3C(CCC4)(CN2C(=O)C1)O)[O-] |
| SMILES (Isomeric) | C1CC2C3CCC[N+]4(C3C(CCC4)(CN2C(=O)C1)O)[O-] |
| InChI | InChI=1S/C15H24N2O3/c18-13-6-1-5-12-11-4-2-8-17(20)9-3-7-15(19,14(11)17)10-16(12)13/h11-12,14,19H,1-10H2 |
| InChI Key | ANLHCMIGMWZZOT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17869263 g/mol |
| Topological Polar Surface Area (TPSA) | 58.60 Ų |
| XlogP | 0.00 |
| SOPHORANOL-N-OXY |
| NSC-142984 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 91.05% | 93.03% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.79% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.32% | 98.95% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 90.08% | 93.04% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.01% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.45% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.88% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.62% | 97.25% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 84.67% | 91.76% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 84.61% | 97.05% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 82.40% | 95.62% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.94% | 99.23% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 81.53% | 94.78% |
| CHEMBL238 | Q01959 | Dopamine transporter | 81.51% | 95.88% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.28% | 96.38% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.72% | 95.89% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 80.05% | 94.66% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sophora flavescens |
| Sophora tonkinensis |
| PubChem | 285668 |
| LOTUS | LTS0223382 |
| wikiData | Q104397343 |