Solwaric acid A
| Internal ID | 66e32b2b-a73f-452c-8467-e5392e2b331e |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Medium-chain fatty acids |
| IUPAC Name | 8-(4-methyl-2-prop-2-enylphenyl)octanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C18H26O2/c1-3-9-17-14-15(2)12-13-16(17)10-7-5-4-6-8-11-18(19)20/h3,12-14H,1,4-11H2,2H3,(H,19,20) |
| InChI Key | WQSRLGOQJXDJSY-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.193280068 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 5.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.92% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.65% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.56% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.53% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.82% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.49% | 94.73% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.44% | 95.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.51% | 86.33% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 85.49% | 96.25% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 85.10% | 92.51% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.81% | 94.62% |
| CHEMBL4330 | Q9NS75 | Cysteinyl leukotriene receptor 2 | 84.42% | 98.00% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 84.38% | 86.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.32% | 96.00% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 82.76% | 97.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.47% | 96.95% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.53% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139584026 |
| LOTUS | LTS0133735 |
| wikiData | Q77278679 |