soldanelline B
| Internal ID | a5cf57b1-c6fd-485f-b76b-561f64a7a1e0 |
| Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
| IUPAC Name | [(2S,3R,4R,5R,6S)-4-hydroxy-6-methyl-5-[(Z)-2-methylbut-2-enoyl]oxy-2-[[(1S,3S,5R,6R,7S,8R,20S,22R,24R,25S,26S,27R,29S,31R,32R,33R)-6,25,26,32-tetrahydroxy-5,31-bis(hydroxymethyl)-24-methyl-7-[(2S)-2-methylbutanoyl]oxy-10-oxo-20-pentyl-2,4,9,21,23,28,30-heptaoxatetracyclo[27.3.1.03,8.022,27]tritriacontan-33-yl]oxy]oxan-3-yl] (2S,3R)-3-hydroxy-2-methylbutanoate |
| SMILES (Canonical) | CCCCCC1CCCCCCCCCC(=O)OC2C(C(C(OC2OC3C(C(OC(C3OC4C(C(C(C(O4)C)OC(=O)C(=CC)C)O)OC(=O)C(C)C(C)O)OC5C(C(C(OC5O1)C)O)O)CO)O)CO)O)OC(=O)C(C)CC |
| SMILES (Isomeric) | CCCCC[C@H]1CCCCCCCCCC(=O)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2O[C@H]3[C@@H]([C@H](O[C@H]([C@@H]3O[C@H]4[C@@H]([C@@H]([C@H]([C@@H](O4)C)OC(=O)/C(=C\C)/C)O)OC(=O)[C@@H](C)[C@@H](C)O)O[C@@H]5[C@H]([C@@H]([C@H](O[C@H]5O1)C)O)O)CO)O)CO)O)OC(=O)[C@@H](C)CC |
| InChI | InChI=1S/C55H92O24/c1-10-13-19-22-33-23-20-17-15-14-16-18-21-24-36(59)73-47-43(75-50(66)28(5)12-3)38(61)34(25-56)71-54(47)77-44-39(62)35(26-57)72-55(78-45-40(63)37(60)31(8)68-52(45)70-33)48(44)79-53-46(76-51(67)29(6)30(7)58)41(64)42(32(9)69-53)74-49(65)27(4)11-2/h11,28-35,37-48,52-58,60-64H,10,12-26H2,1-9H3/b27-11-/t28-,29-,30+,31+,32-,33-,34+,35+,37+,38+,39+,40-,41+,42-,43-,44-,45+,46+,47+,48+,52-,53-,54-,55-/m0/s1 |
| InChI Key | HIABZTFVWGTGEJ-YOGLWGDYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C55H92O24 |
| Molecular Weight | 1137.30 g/mol |
| Exact Mass | 1136.59785380 g/mol |
| Topological Polar Surface Area (TPSA) | 341.00 Ų |
| XlogP | 5.20 |
| CHEBI:68900 |
| Q27137255 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.27% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.83% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.04% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.32% | 89.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 94.24% | 100.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.06% | 97.25% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 93.05% | 92.88% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.39% | 93.56% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.08% | 92.62% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.04% | 97.29% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.95% | 91.19% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.89% | 99.17% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 90.84% | 98.75% |
| CHEMBL4072 | P07858 | Cathepsin B | 90.73% | 93.67% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 90.58% | 95.64% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.48% | 92.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.99% | 94.45% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.56% | 94.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.27% | 96.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.02% | 97.09% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 86.97% | 83.00% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 86.32% | 96.37% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 85.67% | 97.79% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.94% | 95.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.92% | 95.56% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.81% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.32% | 94.73% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.18% | 89.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.74% | 95.89% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 83.70% | 97.47% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.37% | 91.24% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.48% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.20% | 93.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.49% | 96.47% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.20% | 96.61% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 80.75% | 99.18% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.68% | 96.90% |
| CHEMBL1977 | P11473 | Vitamin D receptor | 80.50% | 99.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Calystegia soldanella |
| Capsicum annuum |
| Euphorbia kansui |
| Euphorbia sapinii |
| PubChem | 70698165 |
| LOTUS | LTS0125589 |
| wikiData | Q105161058 |