Solanocardinol
Internal ID | eadbe587-1f85-4894-9efb-14d624fdd300 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal alkaloids > Solanocapsine-type alkaloids |
IUPAC Name | 10,14,16,20-tetramethyl-23-oxa-18-azahexacyclo[12.11.0.02,11.05,10.015,24.017,22]pentacosane-7,22-diol |
SMILES (Canonical) | CC1CC2(C(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1)O |
SMILES (Isomeric) | CC1CC2(C(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1)O |
InChI | InChI=1S/C27H45NO3/c1-15-13-27(30)24(28-14-15)16(2)23-22(31-27)12-21-19-6-5-17-11-18(29)7-9-25(17,3)20(19)8-10-26(21,23)4/h15-24,28-30H,5-14H2,1-4H3 |
InChI Key | ZHFCFFSSVSIEIR-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C27H45NO3 |
Molecular Weight | 431.70 g/mol |
Exact Mass | 431.33994430 g/mol |
Topological Polar Surface Area (TPSA) | 61.70 Ų |
XlogP | 5.20 |
Solanocardinol |
DTXSID601099375 |
(2S,4aS,4bS,6aS,6bR,7S,7aR,10S,11aR,12aS,13aS,13bR,15aS)-Docosahydro-4a,6a,7,10-tetramethylnaphth[2'',1'':4',5']indeno[1',2':5,6]pyrano[3,2-b]pyridine-2,11a(1H)-diol |
138665-46-0 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.60% | 97.25% |
CHEMBL204 | P00734 | Thrombin | 95.14% | 96.01% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 94.43% | 89.05% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.23% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.54% | 96.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 92.30% | 96.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.04% | 90.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.43% | 100.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.41% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.33% | 94.45% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.28% | 96.61% |
CHEMBL1871 | P10275 | Androgen Receptor | 90.08% | 96.43% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 88.63% | 92.86% |
CHEMBL3045 | P05771 | Protein kinase C beta | 87.64% | 97.63% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.88% | 96.77% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.79% | 92.88% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 86.54% | 96.38% |
CHEMBL237 | P41145 | Kappa opioid receptor | 86.09% | 98.10% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 86.06% | 98.35% |
CHEMBL299 | P17252 | Protein kinase C alpha | 85.79% | 98.03% |
CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 85.42% | 97.56% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 85.27% | 98.99% |
CHEMBL238 | Q01959 | Dopamine transporter | 85.15% | 95.88% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.01% | 92.94% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.30% | 91.03% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 83.97% | 97.31% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.85% | 97.79% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.72% | 82.69% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 83.11% | 95.38% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.33% | 95.50% |
CHEMBL2431 | P31751 | Serine/threonine-protein kinase AKT2 | 82.24% | 98.33% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.99% | 95.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.08% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum lycopersicum |
Solanum neocardenasii |
Solanum thomasiifolium |
PubChem | 73802037 |
LOTUS | LTS0164227 |
wikiData | Q105375689 |