Sodium 4-hydroxybenzoate
| Internal ID | d2c877f9-b104-41d7-82c1-d2d0f4b66a5a |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Hydroxybenzoic acid derivatives |
| IUPAC Name | sodium 4-hydroxybenzoate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C7H6O3.Na/c8-6-3-1-5(2-4-6)7(9)10;/h1-4,8H,(H,9,10);/q;+1/p-1 |
| InChI Key | ZLVSYODPTJZFMK-UHFFFAOYSA-M |
| Popularity | 49 references in papers |
| Molecular Formula | C7H5NaO3 |
| Molecular Weight | 160.10 g/mol |
| Exact Mass | 160.01363830 g/mol |
| Topological Polar Surface Area (TPSA) | 60.40 Ų |
| XlogP | 0.00 |
| Sodium p-hydroxybenzoate |
| 4-Hydroxybenzoic acid sodium salt |
| sodium paraben |
| Benzoic acid, 4-hydroxy-, monosodium salt |
| Monosodium p-hydroxybenzoate |
| p-Hydroxybenzoic acid sodium salt |
| Monosodium 4-hydroxybenzoate |
| Benzoic acid, 4-hydroxy-, sodium salt (1:1) |
| EINECS 204-051-1 |
| p-hydroxybenzoic acid monosodium salt |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL261 | P00915 | Carbonic anhydrase I |
7610 nM |
Ki |
PMID: 21402476
|
| CHEMBL205 | P00918 | Carbonic anhydrase II |
7280 nM |
Ki |
PMID: 21402476
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.88% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.22% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.04% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.20% | 99.17% |
| CHEMBL3194 | P02766 | Transthyretin | 81.85% | 90.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.70% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.52% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 16219477 |
| NPASS | NPC184658 |
| ChEMBL | CHEMBL1762656 |