Sissotrine
Internal ID | 892936e4-78ac-4111-9d74-084e4590b98a |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavonoid O-glycosides |
IUPAC Name | 5-hydroxy-3-(4-methoxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | COC1=CC=C(C=C1)C2=COC3=CC(=CC(=C3C2=O)O)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | COC1=CC=C(C=C1)C2=COC3=CC(=CC(=C3C2=O)O)OC4C(C(C(C(O4)CO)O)O)O |
InChI | InChI=1S/C22H22O10/c1-29-11-4-2-10(3-5-11)13-9-30-15-7-12(6-14(24)17(15)18(13)25)31-22-21(28)20(27)19(26)16(8-23)32-22/h2-7,9,16,19-24,26-28H,8H2,1H3 |
InChI Key | LFEUICHQZGNOHD-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C22H22O10 |
Molecular Weight | 446.40 g/mol |
Exact Mass | 446.12129689 g/mol |
Topological Polar Surface Area (TPSA) | 155.00 Ų |
XlogP | 1.20 |
BIOCHANIN A 7-O-B-D-GLUCOPYRANOSIDE |
5928-26-7 |
biochanin A-7-O-glucoside |
NSC-289565 |
Biochanin-7-O-glucoside |
Oprea1_163414 |
MLS001360570 |
CHEMBL1405026 |
SCHEMBL21013018 |
DTXSID50974707 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.20% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.50% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.70% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.69% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.17% | 96.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 93.40% | 86.92% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.04% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.95% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.25% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.59% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.58% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.14% | 99.17% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.99% | 96.21% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.26% | 90.00% |
CHEMBL1907 | P15144 | Aminopeptidase N | 86.93% | 93.31% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.06% | 97.28% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.75% | 95.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.90% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.97% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cicer arietinum |
Cicer flexuosum |
Cicer mogoltavicum |
Cicer songaricum |
Dalbergia sissoo |
Genista pichisermolliana |
Trifolium aureum |
Trifolium diffusum |
Trifolium subterraneum |
PubChem | 5358913 |
LOTUS | LTS0212645 |
wikiData | Q105150983 |