Siphonazole B
| Internal ID | 98d8fa1a-c579-4e9f-b0e2-abc5bcae1635 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Methoxybenzenes > Dimethoxybenzenes |
| IUPAC Name | 2-[2-[2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5-methyl-1,3-oxazol-4-yl]-2-oxoethyl]-5-methyl-N-[(2E)-penta-2,4-dienyl]-1,3-oxazole-4-carboxamide |
| SMILES (Canonical) | CC1=C(N=C(O1)CC(=O)C2=C(OC(=N2)C=CC3=CC(=C(C=C3)OC)OC)C)C(=O)NCC=CC=C |
| SMILES (Isomeric) | CC1=C(N=C(O1)CC(=O)C2=C(OC(=N2)/C=C/C3=CC(=C(C=C3)OC)OC)C)C(=O)NC/C=C/C=C |
| InChI | InChI=1S/C26H27N3O6/c1-6-7-8-13-27-26(31)25-17(3)35-23(29-25)15-19(30)24-16(2)34-22(28-24)12-10-18-9-11-20(32-4)21(14-18)33-5/h6-12,14H,1,13,15H2,2-5H3,(H,27,31)/b8-7+,12-10+ |
| InChI Key | UITIGNAMFIILBO-DCXZXJRMSA-N |
| Popularity | 8 references in papers |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.18998559 g/mol |
| Topological Polar Surface Area (TPSA) | 117.00 Ų |
| XlogP | 4.30 |
| 2-[2-[2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5-methyl-1,3-oxazol-4-yl]-2-oxoethyl]-5-methyl-N-[(2E)-penta-2,4-dienyl]-1,3-oxazole-4-carboxamide |
| 2-(2-(2-((E)-2-(3,4-dimethoxyphenyl)ethenyl)-5-methyl-1,3-oxazol-4-yl)-2-oxoethyl)-5-methyl-N-((2E)-penta-2,4-dienyl)-1,3-oxazole-4-carboxamide |
| RefChem:183217 |
| CHEBI:200399 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 98.17% | 96.00% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 97.63% | 87.67% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.90% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.69% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.64% | 99.17% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.16% | 83.82% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.42% | 90.20% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 89.94% | 81.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.02% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.85% | 90.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.36% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.24% | 94.45% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 83.80% | 89.63% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.10% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.50% | 89.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.13% | 95.50% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 80.75% | 97.53% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.56% | 89.62% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 80.40% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 25172105 |
| LOTUS | LTS0095135 |
| wikiData | Q77278640 |