Siomycin D1
| Internal ID | 1fd5869a-a3e2-4068-9148-cd08f4917337 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | N-[3-[(3-amino-3-oxoprop-1-en-2-yl)amino]-3-oxoprop-1-en-2-yl]-2-[(1R,8S,11Z,15R,18R,25R,26S,35R,37R,46R,53S,59S)-18-[(2R,3S)-2,3-dihydroxybutan-2-yl]-11-ethylidene-59-hydroxy-8-[(1S)-1-hydroxyethyl]-31-(hydroxymethyl)-26,46-dimethyl-40,43-dimethylidene-6,9,16,23,28,38,41,44,47-nonaoxo-37-propan-2-yl-27-oxa-3,13,20,56-tetrathia-7,10,17,24,36,39,42,45,48,52,58,61,62,63,64-pentadecazanonacyclo[23.23.9.329,35.12,5.112,15.119,22.154,57.01,53.032,60]tetrahexaconta-2(64),4,12(63),19(62),21,29(61),30,32(60),33,51,54,57-dodecaen-51-yl]-1,3-thiazole-4-carboxamide |
| SMILES (Canonical) | CC=C1C2=NC(CS2)C(=O)NC(C3=NC(=CS3)C(=O)NC4C(OC(=O)C5=NC6=C(C=CC(C6O)NC(C(=O)NC(=C)C(=O)NC(=C)C(=O)NC(C(=O)NC7(CCC(=NC7C8=CSC4=N8)C9=NC(=CS9)C(=O)NC(=C)C(=O)NC(=C)C(=O)N)C2=NC(=CS2)C(=O)NC(C(=O)N1)C(C)O)C)C(C)C)C(=C5)CO)C)C(C)(C(C)O)O |
| SMILES (Isomeric) | C/C=C\1/C2=N[C@@H](CS2)C(=O)N[C@@H](C3=NC(=CS3)C(=O)N[C@@H]4[C@@H](OC(=O)C5=NC6=C(C=C[C@H]([C@@H]6O)N[C@@H](C(=O)NC(=C)C(=O)NC(=C)C(=O)N[C@@H](C(=O)N[C@@]7(CCC(=N[C@@H]7C8=CSC4=N8)C9=NC(=CS9)C(=O)NC(=C)C(=O)NC(=C)C(=O)N)C2=NC(=CS2)C(=O)N[C@H](C(=O)N1)[C@H](C)O)C)C(C)C)C(=C5)CO)C)[C@](C)([C@H](C)O)O |
| InChI | InChI=1S/C70H79N19O18S5/c1-13-36-63-82-43(22-108-63)60(102)88-51(69(12,106)33(11)92)66-84-42(23-111-66)58(100)87-47-32(10)107-67(105)39-18-34(19-90)35-14-15-37(49(93)48(35)78-39)77-45(25(2)3)61(103)76-29(7)55(97)73-27(5)54(96)74-30(8)56(98)89-70(68-85-44(24-112-68)59(101)86-46(31(9)91)62(104)80-36)17-16-38(79-50(70)40-20-110-65(47)81-40)64-83-41(21-109-64)57(99)75-28(6)53(95)72-26(4)52(71)94/h13-15,18,20-21,23-25,30-33,37,43,45-47,49-51,77,90-93,106H,4-7,16-17,19,22H2,1-3,8-12H3,(H2,71,94)(H,72,95)(H,73,97)(H,74,96)(H,75,99)(H,76,103)(H,80,104)(H,86,101)(H,87,100)(H,88,102)(H,89,98)/b36-13-/t30-,31+,32+,33+,37-,43+,45-,46+,47-,49+,50-,51+,69+,70-/m1/s1 |
| InChI Key | GZXVYCZTRLJOKW-MTDZEBIFSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C70H79N19O18S5 |
| Molecular Weight | 1634.80 g/mol |
| Exact Mass | 1633.4454026 g/mol |
| Topological Polar Surface Area (TPSA) | 701.00 Ų |
| XlogP | 0.10 |
| Atomic LogP (AlogP) | -0.05 |
| H-Bond Acceptor | 31 |
| H-Bond Donor | 17 |
| Rotatable Bonds | 11 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.5840 | 58.40% |
| Caco-2 | - | 0.8600 | 86.00% |
| Blood Brain Barrier | - | 0.8000 | 80.00% |
| Human oral bioavailability | - | 0.7857 | 78.57% |
| Subcellular localzation | Mitochondria | 0.4688 | 46.88% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8009 | 80.09% |
| OATP1B3 inhibitior | + | 0.9346 | 93.46% |
| MATE1 inhibitior | - | 0.9246 | 92.46% |
| OCT2 inhibitior | - | 0.8750 | 87.50% |
| BSEP inhibitior | + | 0.9645 | 96.45% |
| P-glycoprotein inhibitior | + | 0.7419 | 74.19% |
| P-glycoprotein substrate | + | 0.8636 | 86.36% |
| CYP3A4 substrate | + | 0.7638 | 76.38% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8514 | 85.14% |
| CYP3A4 inhibition | - | 0.5906 | 59.06% |
| CYP2C9 inhibition | - | 0.8094 | 80.94% |
| CYP2C19 inhibition | - | 0.7781 | 77.81% |
| CYP2D6 inhibition | - | 0.8902 | 89.02% |
| CYP1A2 inhibition | - | 0.8123 | 81.23% |
| CYP2C8 inhibition | + | 0.8717 | 87.17% |
| CYP inhibitory promiscuity | - | 0.5533 | 55.33% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8900 | 89.00% |
| Carcinogenicity (trinary) | Non-required | 0.5560 | 55.60% |
| Eye corrosion | - | 0.9812 | 98.12% |
| Eye irritation | - | 0.8954 | 89.54% |
| Skin irritation | - | 0.7578 | 75.78% |
| Skin corrosion | - | 0.9155 | 91.55% |
| Ames mutagenesis | + | 0.5200 | 52.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7067 | 70.67% |
| Micronuclear | + | 0.7600 | 76.00% |
| Hepatotoxicity | - | 0.5446 | 54.46% |
| skin sensitisation | - | 0.8151 | 81.51% |
| Respiratory toxicity | + | 0.8667 | 86.67% |
| Reproductive toxicity | + | 0.8889 | 88.89% |
| Mitochondrial toxicity | + | 0.9375 | 93.75% |
| Nephrotoxicity | - | 0.8589 | 85.89% |
| Acute Oral Toxicity (c) | III | 0.5742 | 57.42% |
| Estrogen receptor binding | - | 0.5836 | 58.36% |
| Androgen receptor binding | + | 0.8269 | 82.69% |
| Thyroid receptor binding | + | 0.8342 | 83.42% |
| Glucocorticoid receptor binding | + | 0.8905 | 89.05% |
| Aromatase binding | + | 0.8073 | 80.73% |
| PPAR gamma | + | 0.8655 | 86.55% |
| Honey bee toxicity | - | 0.6001 | 60.01% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | - | 0.5800 | 58.00% |
| Fish aquatic toxicity | + | 0.9027 | 90.27% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.66% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.60% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.92% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.77% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.14% | 85.14% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 97.82% | 89.63% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 97.74% | 95.71% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 97.44% | 98.03% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.08% | 95.56% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 95.72% | 93.03% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 95.55% | 96.47% |
| CHEMBL204 | P00734 | Thrombin | 93.74% | 96.01% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 93.54% | 96.21% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.33% | 94.75% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 92.64% | 89.34% |
| CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 91.82% | 97.03% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 91.48% | 92.88% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.27% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.25% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.19% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.02% | 86.33% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 89.55% | 91.24% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.50% | 96.38% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.31% | 90.71% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 88.41% | 95.69% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 88.19% | 93.10% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.00% | 92.62% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.99% | 96.90% |
| CHEMBL5028 | O14672 | ADAM10 | 86.89% | 97.50% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.86% | 94.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.81% | 90.17% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.19% | 97.14% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 86.16% | 89.67% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 85.98% | 99.29% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.56% | 100.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.90% | 89.50% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.15% | 93.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.14% | 94.73% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 83.67% | 95.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.52% | 91.07% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 82.77% | 92.95% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.36% | 96.61% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 82.12% | 88.42% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.11% | 97.09% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 82.08% | 95.56% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.74% | 95.50% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 81.62% | 88.56% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 81.05% | 87.67% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 81.04% | 80.71% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.97% | 90.08% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.84% | 94.23% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.82% | 95.50% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.64% | 98.75% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 80.40% | 83.10% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 80.37% | 80.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139589106 |
| LOTUS | LTS0125414 |
| wikiData | Q105024714 |