sinolignan A
Internal ID | 5ec544f7-f7a0-4d0f-9eb6-bfa49b966752 |
Taxonomy | Lignans, neolignans and related compounds > Lignan lactones > Podophyllotoxins |
IUPAC Name | [(2R,3S,4S,5R,6R)-6-[[(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
SMILES (Canonical) | CC(=O)OCC1C(C(C(C(O1)OC2C3COC(=O)C3C(C4=CC5=C(C=C24)OCO5)C6=CC(=C(C(=C6)OC)OC)OC)O)O)O |
SMILES (Isomeric) | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]3COC(=O)[C@@H]3[C@@H](C4=CC5=C(C=C24)OCO5)C6=CC(=C(C(=C6)OC)OC)OC)O)O)O |
InChI | InChI=1S/C30H34O14/c1-12(31)39-10-21-24(32)25(33)26(34)30(43-21)44-27-15-8-18-17(41-11-42-18)7-14(15)22(23-16(27)9-40-29(23)35)13-5-19(36-2)28(38-4)20(6-13)37-3/h5-8,16,21-27,30,32-34H,9-11H2,1-4H3/t16-,21+,22+,23-,24+,25-,26+,27-,30-/m0/s1 |
InChI Key | DPKLCDRVJXJAEF-TZGCRGLASA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H34O14 |
Molecular Weight | 618.60 g/mol |
Exact Mass | 618.19485575 g/mol |
Topological Polar Surface Area (TPSA) | 178.00 Ų |
XlogP | 0.40 |
CHEMBL1778158 |
(5R)-5beta-(3,4,5-Trimethoxyphenyl)-9beta-(6-O-acetyl-beta-D-glucopyranosyloxy)-5,5aalpha,6,8,8abeta,9-hexahydrofuro[3',4':6,7]naphtho[2,3-d]-1,3-dioxole-6-one |
![2D Structure of sinolignan A 2D Structure of sinolignan A](https://plantaedb.com/storage/docs/compounds/2023/07/sinolignan-a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.78% | 85.14% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.90% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.69% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.68% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.29% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.70% | 94.45% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.50% | 96.77% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.94% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.30% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.98% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.73% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 87.54% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.36% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.20% | 95.56% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.17% | 89.62% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.02% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.38% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.46% | 94.73% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.03% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.74% | 100.00% |
CHEMBL2535 | P11166 | Glucose transporter | 82.50% | 98.75% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.84% | 94.80% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.44% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dimorphotheca sinuata |
Heptapleurum capitatum |
Podophyllum hexandrum |
Roldana mexicana |
PubChem | 54581698 |
NPASS | NPC100465 |
ChEMBL | CHEMBL1778158 |
LOTUS | LTS0226606 |
wikiData | Q104986552 |