Siamenol
Internal ID | c7a9ca4d-1710-4148-b7c5-67cb9ad669c6 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | 6-methyl-3-(3-methylbut-2-enyl)-9H-carbazol-2-ol |
SMILES (Canonical) | CC1=CC2=C(C=C1)NC3=C2C=C(C(=C3)O)CC=C(C)C |
SMILES (Isomeric) | CC1=CC2=C(C=C1)NC3=C2C=C(C(=C3)O)CC=C(C)C |
InChI | InChI=1S/C18H19NO/c1-11(2)4-6-13-9-15-14-8-12(3)5-7-16(14)19-17(15)10-18(13)20/h4-5,7-10,19-20H,6H2,1-3H3 |
InChI Key | BBPNJGRZPSCZBB-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C18H19NO |
Molecular Weight | 265.30 g/mol |
Exact Mass | 265.146664230 g/mol |
Topological Polar Surface Area (TPSA) | 36.00 Ų |
XlogP | 5.30 |
CHEBI:66479 |
6-methyl-3-(3-methylbut-2-enyl)-9H-carbazol-2-ol |
6-methyl-3-(3-methylbut-2-en-1-yl)-9H-carbazol-2-ol |
264622-44-8 |
CHEMBL444482 |
SCHEMBL3127873 |
6-Methyl-3-(3-methyl-but-2-enyl)-9H-carbazol-2-ol |
Q27135080 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.92% | 91.11% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 96.80% | 91.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.66% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 92.86% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.80% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.16% | 94.73% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.38% | 91.49% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.95% | 85.14% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.67% | 94.75% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.92% | 96.09% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.67% | 89.62% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.79% | 93.99% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 85.78% | 98.59% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 84.28% | 85.49% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.56% | 93.18% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.40% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 81.24% | 98.75% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.56% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Murraya koenigii |
PubChem | 477436 |
NPASS | NPC94943 |
ChEMBL | CHEMBL444482 |
LOTUS | LTS0213272 |
wikiData | Q27135080 |