Shikonofuran E
Internal ID | e01819ae-71be-44a3-a256-ad088f4082ee |
Taxonomy | Benzenoids > Phenols > Benzenediols > Hydroquinones |
IUPAC Name | [1-[5-(2,5-dihydroxyphenyl)furan-3-yl]-4-methylpent-3-enyl] 3-methylbut-2-enoate |
SMILES (Canonical) | CC(=CCC(C1=COC(=C1)C2=C(C=CC(=C2)O)O)OC(=O)C=C(C)C)C |
SMILES (Isomeric) | CC(=CCC(C1=COC(=C1)C2=C(C=CC(=C2)O)O)OC(=O)C=C(C)C)C |
InChI | InChI=1S/C21H24O5/c1-13(2)5-8-19(26-21(24)9-14(3)4)15-10-20(25-12-15)17-11-16(22)6-7-18(17)23/h5-7,9-12,19,22-23H,8H2,1-4H3 |
InChI Key | MIIXCJKPPPUPOJ-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H24O5 |
Molecular Weight | 356.40 g/mol |
Exact Mass | 356.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 79.90 Ų |
XlogP | 5.10 |
CHEMBL1944654 |
BDBM50363753 |
85022-62-4 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.43% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.35% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.72% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.07% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.50% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.50% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.89% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.40% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.73% | 89.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.27% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.13% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.63% | 95.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.82% | 96.95% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.76% | 91.07% |
CHEMBL3194 | P02766 | Transthyretin | 81.31% | 90.71% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.58% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lithospermum erythrorhizon |
PubChem | 5321290 |
NPASS | NPC308799 |
ChEMBL | CHEMBL1944654 |
LOTUS | LTS0182855 |
wikiData | Q104393184 |