Shikonofuran D
Internal ID | 609ade41-9677-4cc7-90fb-fd5bd74730dc |
Taxonomy | Benzenoids > Phenols > Benzenediols > Hydroquinones |
IUPAC Name | [1-[5-(2,5-dihydroxyphenyl)furan-3-yl]-4-methylpent-3-enyl] 2-methylpropanoate |
SMILES (Canonical) | CC(C)C(=O)OC(CC=C(C)C)C1=COC(=C1)C2=C(C=CC(=C2)O)O |
SMILES (Isomeric) | CC(C)C(=O)OC(CC=C(C)C)C1=COC(=C1)C2=C(C=CC(=C2)O)O |
InChI | InChI=1S/C20H24O5/c1-12(2)5-8-18(25-20(23)13(3)4)14-9-19(24-11-14)16-10-15(21)6-7-17(16)22/h5-7,9-11,13,18,21-22H,8H2,1-4H3 |
InChI Key | CXGBJXJKCPQSQI-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H24O5 |
Molecular Weight | 344.40 g/mol |
Exact Mass | 344.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 79.90 Ų |
XlogP | 4.70 |
CHEMBL1946216 |
BDBM50363754 |
85022-63-5 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.53% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.40% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.69% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.65% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.91% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.31% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.16% | 94.73% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.25% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.63% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.01% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.70% | 89.00% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 85.40% | 93.10% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.76% | 91.07% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.32% | 90.00% |
CHEMBL3194 | P02766 | Transthyretin | 82.18% | 90.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.03% | 95.89% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.86% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lithospermum erythrorhizon |
PubChem | 5321289 |
NPASS | NPC61284 |
ChEMBL | CHEMBL1946216 |