Sesteralterin
| Internal ID | c0ce6547-d117-4370-856e-aeb1f1e51ec9 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
| IUPAC Name | (2R,4S,5R,7R,8R,10R,11S,14S,15S,17S)-2,7-dihydroxy-8,11,15-trimethyl-5-propan-2-yl-18-oxapentacyclo[12.5.1.02,10.04,8.017,20]icos-1(20)-en-19-one |
| SMILES (Canonical) | CC1CCC2C(CC3C2=C(C(=O)O3)C4(C1CC5(C(CC(C5C4)C(C)C)O)C)O)C |
| SMILES (Isomeric) | C[C@H]1CC[C@H]2[C@H](C[C@H]3C2=C(C(=O)O3)[C@@]4([C@@H]1C[C@]5([C@@H](C[C@@H]([C@@H]5C4)C(C)C)O)C)O)C |
| InChI | InChI=1S/C25H38O4/c1-12(2)16-9-20(26)24(5)10-17-13(3)6-7-15-14(4)8-19-21(15)22(23(27)29-19)25(17,28)11-18(16)24/h12-20,26,28H,6-11H2,1-5H3/t13-,14-,15-,16+,17+,18-,19-,20+,24+,25+/m0/s1 |
| InChI Key | JZCCXPJAWWWRFI-NAUUZKHFSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.27700969 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 4.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.40% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.19% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.85% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.71% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.68% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.99% | 96.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 91.34% | 96.38% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.60% | 96.47% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.22% | 96.77% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.31% | 98.95% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.02% | 97.14% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.94% | 82.69% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.65% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.70% | 99.23% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.28% | 93.04% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.27% | 95.89% |
| CHEMBL1871 | P10275 | Androgen Receptor | 81.16% | 96.43% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.58% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.36% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139589790 |
| LOTUS | LTS0122514 |
| wikiData | Q105137340 |