Serratidine
Internal ID | 9584657f-580b-4f79-bd4b-f257862e1207 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | (1S,10S,13R)-13-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-2-en-11-one |
SMILES (Canonical) | CC1CC2(CC(=O)C3CCCN4C3(C1)C2=CCC4)O |
SMILES (Isomeric) | CC1C[C@]2(CC(=O)[C@H]3CCCN4[C@]3(C1)C2=CCC4)O |
InChI | InChI=1S/C16H23NO2/c1-11-8-15(19)10-13(18)12-4-2-6-17-7-3-5-14(15)16(12,17)9-11/h5,11-12,19H,2-4,6-10H2,1H3/t11?,12-,15-,16+/m1/s1 |
InChI Key | SEWDNOQXMYWSRQ-ARQBPDDDSA-N |
Popularity | 2 references in papers |
Molecular Formula | C16H23NO2 |
Molecular Weight | 261.36 g/mol |
Exact Mass | 261.172878976 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 0.60 |
There are no found synonyms. |
![2D Structure of Serratidine 2D Structure of Serratidine](https://plantaedb.com/storage/docs/compounds/2023/11/serratidine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.68% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.99% | 91.11% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.76% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 91.66% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.51% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.00% | 95.56% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.48% | 92.94% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 88.71% | 93.04% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.68% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.27% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.61% | 100.00% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 85.35% | 86.00% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 84.94% | 90.24% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.49% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.72% | 89.00% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 82.62% | 94.78% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.04% | 96.77% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.35% | 85.14% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.14% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Huperzia selago |
Huperzia serrata |
PubChem | 20056306 |
LOTUS | LTS0117204 |
wikiData | Q105251565 |