Ser-Phe-Lys-Leu-Cys-Pro-Gly-Gly-Gln-Cys-Val
| Internal ID | 31daea02-b898-4b5b-a401-67ba3a2f01f4 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
| IUPAC Name | (2S)-2-[[(2R)-2-[[(2S)-5-amino-2-[[2-[[2-[[(2S)-1-[(2R)-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-4-methylpentanoyl]amino]-3-sulfanylpropanoyl]pyrrolidine-2-carbonyl]amino]acetyl]amino]acetyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-methylbutanoic acid |
| SMILES (Canonical) | CC(C)CC(C(=O)NC(CS)C(=O)N1CCCC1C(=O)NCC(=O)NCC(=O)NC(CCC(=O)N)C(=O)NC(CS)C(=O)NC(C(C)C)C(=O)O)NC(=O)C(CCCCN)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(CO)N |
| SMILES (Isomeric) | CC(C)C[C@@H](C(=O)N[C@@H](CS)C(=O)N1CCC[C@H]1C(=O)NCC(=O)NCC(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CS)C(=O)N[C@@H](C(C)C)C(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@H](CO)N |
| InChI | InChI=1S/C49H79N13O14S2/c1-26(2)19-32(58-42(68)30(13-8-9-17-50)56-45(71)33(57-41(67)29(51)23-63)20-28-11-6-5-7-12-28)44(70)60-35(25-78)48(74)62-18-10-14-36(62)47(73)54-21-38(65)53-22-39(66)55-31(15-16-37(52)64)43(69)59-34(24-77)46(72)61-40(27(3)4)49(75)76/h5-7,11-12,26-27,29-36,40,63,77-78H,8-10,13-25,50-51H2,1-4H3,(H2,52,64)(H,53,65)(H,54,73)(H,55,66)(H,56,71)(H,57,67)(H,58,68)(H,59,69)(H,60,70)(H,61,72)(H,75,76)/t29-,30-,31-,32-,33-,34-,35-,36-,40-/m0/s1 |
| InChI Key | PMCVRTPALFYVSL-MJAVZSKTSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C49H79N13O14S2 |
| Molecular Weight | 1138.40 g/mol |
| Exact Mass | 1137.53108659 g/mol |
| Topological Polar Surface Area (TPSA) | 437.00 Ų |
| XlogP | -4.80 |
| Atomic LogP (AlogP) | -4.79 |
| H-Bond Acceptor | 17 |
| H-Bond Donor | 16 |
| Rotatable Bonds | 35 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6570 | 65.70% |
| Caco-2 | - | 0.8646 | 86.46% |
| Blood Brain Barrier | - | 0.8250 | 82.50% |
| Human oral bioavailability | - | 0.6429 | 64.29% |
| Subcellular localzation | Mitochondria | 0.5116 | 51.16% |
| OATP2B1 inhibitior | - | 0.8584 | 85.84% |
| OATP1B1 inhibitior | + | 0.8722 | 87.22% |
| OATP1B3 inhibitior | + | 0.9365 | 93.65% |
| MATE1 inhibitior | - | 0.9400 | 94.00% |
| OCT2 inhibitior | - | 0.9500 | 95.00% |
| BSEP inhibitior | + | 0.8731 | 87.31% |
| P-glycoprotein inhibitior | + | 0.7427 | 74.27% |
| P-glycoprotein substrate | + | 0.8545 | 85.45% |
| CYP3A4 substrate | + | 0.7225 | 72.25% |
| CYP2C9 substrate | - | 0.8002 | 80.02% |
| CYP2D6 substrate | - | 0.8113 | 81.13% |
| CYP3A4 inhibition | - | 0.8655 | 86.55% |
| CYP2C9 inhibition | - | 0.9291 | 92.91% |
| CYP2C19 inhibition | - | 0.8165 | 81.65% |
| CYP2D6 inhibition | - | 0.9250 | 92.50% |
| CYP1A2 inhibition | - | 0.9051 | 90.51% |
| CYP2C8 inhibition | + | 0.5807 | 58.07% |
| CYP inhibitory promiscuity | - | 0.9422 | 94.22% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8500 | 85.00% |
| Carcinogenicity (trinary) | Non-required | 0.6556 | 65.56% |
| Eye corrosion | - | 0.9883 | 98.83% |
| Eye irritation | - | 0.8973 | 89.73% |
| Skin irritation | - | 0.7873 | 78.73% |
| Skin corrosion | - | 0.9344 | 93.44% |
| Ames mutagenesis | - | 0.7478 | 74.78% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6566 | 65.66% |
| Micronuclear | + | 0.7600 | 76.00% |
| Hepatotoxicity | - | 0.5329 | 53.29% |
| skin sensitisation | - | 0.8831 | 88.31% |
| Respiratory toxicity | + | 0.9000 | 90.00% |
| Reproductive toxicity | + | 0.9444 | 94.44% |
| Mitochondrial toxicity | + | 0.9500 | 95.00% |
| Nephrotoxicity | - | 0.9285 | 92.85% |
| Acute Oral Toxicity (c) | III | 0.6115 | 61.15% |
| Estrogen receptor binding | + | 0.6906 | 69.06% |
| Androgen receptor binding | + | 0.6525 | 65.25% |
| Thyroid receptor binding | + | 0.5910 | 59.10% |
| Glucocorticoid receptor binding | + | 0.6351 | 63.51% |
| Aromatase binding | + | 0.7106 | 71.06% |
| PPAR gamma | + | 0.7346 | 73.46% |
| Honey bee toxicity | - | 0.7881 | 78.81% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | - | 0.5100 | 51.00% |
| Fish aquatic toxicity | + | 0.8061 | 80.61% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.96% | 98.95% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 99.80% | 98.33% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 99.38% | 98.10% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.59% | 90.17% |
| CHEMBL3837 | P07711 | Cathepsin L | 98.53% | 96.61% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.50% | 89.63% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 98.38% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.73% | 96.09% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 96.76% | 94.45% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 96.68% | 82.69% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 96.60% | 96.67% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.51% | 93.56% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 96.27% | 98.24% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 95.97% | 96.03% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 95.91% | 90.20% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 95.69% | 88.42% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 94.97% | 100.00% |
| CHEMBL4801 | P29466 | Caspase-1 | 94.76% | 96.85% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.66% | 97.09% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 94.61% | 93.00% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 94.58% | 97.23% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 94.23% | 96.47% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.19% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.86% | 99.17% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 92.84% | 96.67% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 92.61% | 98.94% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.81% | 95.56% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 91.38% | 97.64% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.98% | 100.00% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 90.31% | 95.52% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 90.22% | 93.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.20% | 96.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 89.71% | 93.03% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.26% | 97.21% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.54% | 91.19% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.49% | 97.14% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 87.96% | 95.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.50% | 94.45% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 87.50% | 83.14% |
| CHEMBL3018 | Q9Y5Y6 | Matriptase | 87.49% | 98.33% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 87.48% | 98.89% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 87.28% | 89.33% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.93% | 95.89% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 86.90% | 93.10% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 86.89% | 82.86% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 86.52% | 95.00% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 86.08% | 93.18% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.85% | 90.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.82% | 95.89% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 85.54% | 96.37% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 85.06% | 96.67% |
| CHEMBL5028 | O14672 | ADAM10 | 84.83% | 97.50% |
| CHEMBL236 | P41143 | Delta opioid receptor | 84.38% | 99.35% |
| CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 83.92% | 99.77% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 83.49% | 82.38% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.94% | 90.24% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 81.95% | 94.66% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 81.56% | 92.32% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.34% | 95.50% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 81.27% | 97.50% |
| CHEMBL6007 | O75762 | Transient receptor potential cation channel subfamily A member 1 | 80.86% | 92.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.18% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 134825527 |
| LOTUS | LTS0157725 |
| wikiData | Q105211397 |