Senecioic acid amide
| Internal ID | 892e252d-960e-427b-918f-c8c5956bc964 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Carboxylic acid derivatives > Primary carboxylic acid amides |
| IUPAC Name | 3-methylbut-2-enamide |
| SMILES (Canonical) | CC(=CC(=O)N)C |
| SMILES (Isomeric) | CC(=CC(=O)N)C |
| InChI | InChI=1S/C5H9NO/c1-4(2)3-5(6)7/h3H,1-2H3,(H2,6,7) |
| InChI Key | WHNPOQXWAMXPTA-UHFFFAOYSA-N |
| Popularity | 159 references in papers |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.068413911 g/mol |
| Topological Polar Surface Area (TPSA) | 43.10 Ų |
| XlogP | 0.60 |
| Senecioic acid amide |
| 4479-75-8 |
| 3,3-Dimethylacrylamide |
| 3-Methylcrotonamide |
| 2-Isopropylideneacetamide |
| 2-Butenamide, 3-methyl- |
| CROTONAMIDE, 3-METHYL- |
| Dimethylacrylamide |
| BY9K3N18VW |
| NSC-52511 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.71% | 96.09% |
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 83.75% | 97.88% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.11% | 89.34% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.70% | 83.82% |
| CHEMBL4506 | Q96EB6 | NAD-dependent deacetylase sirtuin 1 | 80.13% | 88.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alchornea rugosa |
| PubChem | 20560 |
| LOTUS | LTS0125645 |
| wikiData | Q27274963 |