Sendanolactone
Internal ID | 546d09a3-5f71-403a-ac4d-2f1b178c5dab |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (2S,4S,7R,8S,9S,12R,13R,18R)-2,9,13,17,17-pentamethyl-7-(4-methylpent-3-enyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-1(20)-ene-6,16,19-trione |
SMILES (Canonical) | CC(=CCCC1C2C(CC3(C2(CCC4C3=CC(=O)C5C4(CCC(=O)C5(C)C)C)C)C)OC1=O)C |
SMILES (Isomeric) | CC(=CCC[C@@H]1[C@@H]2[C@H](C[C@]3([C@]2(CC[C@H]4C3=CC(=O)[C@@H]5[C@@]4(CCC(=O)C5(C)C)C)C)C)OC1=O)C |
InChI | InChI=1S/C30H42O4/c1-17(2)9-8-10-18-24-22(34-26(18)33)16-30(7)20-15-21(31)25-27(3,4)23(32)12-13-28(25,5)19(20)11-14-29(24,30)6/h9,15,18-19,22,24-25H,8,10-14,16H2,1-7H3/t18-,19+,22+,24-,25+,28-,29+,30-/m1/s1 |
InChI Key | TZPDGDWBWUZEAM-LPYLZKPHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H42O4 |
Molecular Weight | 466.70 g/mol |
Exact Mass | 466.30830982 g/mol |
Topological Polar Surface Area (TPSA) | 60.40 Ų |
XlogP | 5.80 |
64929-59-5 |
HY-N1281 |
AKOS032962368 |
FS-8920 |
CS-0016685 |
(2S,4S,7R,8S,9S,12R,13R,18R)-2,9,13,17,17-pentamethyl-7-(4-methylpent-3-enyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-1(20)-ene-6,16,19-trione |
![2D Structure of Sendanolactone 2D Structure of Sendanolactone](https://plantaedb.com/storage/docs/compounds/2023/11/sendanolactone.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.69% | 96.09% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 96.67% | 94.78% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.91% | 91.11% |
CHEMBL204 | P00734 | Thrombin | 93.90% | 96.01% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.17% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.32% | 86.33% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.01% | 96.38% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.25% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.34% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.04% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.54% | 97.25% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.25% | 93.99% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.16% | 94.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.63% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.49% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 81.59% | 98.95% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.22% | 93.40% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.12% | 82.69% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.00% | 85.14% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.62% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Melia azedarach |
PubChem | 15906464 |
LOTUS | LTS0080701 |
wikiData | Q105268305 |