Sempervirenoside B
Internal ID | 505faeca-97d5-41a0-9c75-bdd547b0a447 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | [(3S,5S,6S)-5-hydroxy-6-[5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxo-7-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-2-methyl-4-[(2S,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl] acetate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=C(C2=O)C(=CC(=C3CC=C(C)C)OC4C(C(C(C(O4)CO)O)O)O)O)C5=CC=C(C=C5)OC)O)OC6C(C(C(CO6)O)O)O)OC(=O)C |
SMILES (Isomeric) | CC1[C@@H](C([C@@H]([C@@H](O1)OC2=C(OC3=C(C2=O)C(=CC(=C3CC=C(C)C)O[C@H]4C([C@H]([C@@H](C(O4)CO)O)O)O)O)C5=CC=C(C=C5)OC)O)O[C@H]6C([C@H]([C@@H](CO6)O)O)O)OC(=O)C |
InChI | InChI=1S/C40H50O20/c1-15(2)6-11-20-23(56-39-31(50)29(48)27(46)24(13-41)57-39)12-21(43)25-28(47)36(34(58-35(20)25)18-7-9-19(52-5)10-8-18)60-40-32(51)37(33(16(3)54-40)55-17(4)42)59-38-30(49)26(45)22(44)14-53-38/h6-10,12,16,22,24,26-27,29-33,37-41,43-46,48-51H,11,13-14H2,1-5H3/t16?,22-,24?,26+,27-,29+,30?,31?,32+,33+,37?,38+,39-,40+/m1/s1 |
InChI Key | OQCRMRUPRKFSAM-ZWXIZAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H50O20 |
Molecular Weight | 850.80 g/mol |
Exact Mass | 850.28954398 g/mol |
Topological Polar Surface Area (TPSA) | 299.00 Ų |
XlogP | 0.70 |
CHEBI:186535 |
LMPK12112022 |
[(3S,5S,6S)-5-hydroxy-6-[5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxo-7-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-2-methyl-4-[(2S,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl] acetate |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.93% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.97% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 96.96% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.77% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.18% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.64% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.11% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.76% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.20% | 95.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 92.12% | 86.92% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.14% | 96.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.67% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.03% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.50% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.84% | 91.49% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.76% | 90.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.31% | 92.94% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.89% | 91.19% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.27% | 95.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.51% | 97.09% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 84.19% | 87.67% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.66% | 99.23% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.86% | 96.77% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.36% | 92.62% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.04% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Epimedium sempervirens |
PubChem | 44259073 |
LOTUS | LTS0213429 |
wikiData | Q105196716 |