Selaginellin
Internal ID | e166edc9-d1c8-4722-9e8a-d8a67563a11a |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | 4-[[3-(hydroxymethyl)-6-(4-hydroxyphenyl)-2-[2-(4-hydroxyphenyl)ethynyl]phenyl]-(4-hydroxyphenyl)methylidene]cyclohexa-2,5-dien-1-one |
SMILES (Canonical) | C1=CC(=O)C=CC1=C(C2=CC=C(C=C2)O)C3=C(C=CC(=C3C#CC4=CC=C(C=C4)O)CO)C5=CC=C(C=C5)O |
SMILES (Isomeric) | C1=CC(=O)C=CC1=C(C2=CC=C(C=C2)O)C3=C(C=CC(=C3C#CC4=CC=C(C=C4)O)CO)C5=CC=C(C=C5)O |
InChI | InChI=1S/C34H24O5/c35-21-26-10-20-31(23-4-13-28(37)14-5-23)34(32(26)19-3-22-1-11-27(36)12-2-22)33(24-6-15-29(38)16-7-24)25-8-17-30(39)18-9-25/h1-2,4-18,20,35-38H,21H2 |
InChI Key | SJSFYXIEVFIZJC-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C34H24O5 |
Molecular Weight | 512.50 g/mol |
Exact Mass | 512.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 98.00 Ų |
XlogP | 6.30 |
941269-84-7 |
CHEMBL3394769 |
4-[[3-(hydroxymethyl)-6-(4-hydroxyphenyl)-2-[2-(4-hydroxyphenyl)ethynyl]phenyl]-(4-hydroxyphenyl)methylidene]cyclohexa-2,5-dien-1-one |
BDBM50060922 |
AKOS040763526 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B |
15900 nM 4600 nM |
IC50 IC50 |
DOI: 10.6019/CHEMBL1201861
DOI: 10.6019/CHEMBL1201861 |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL242 | Q92731 | Estrogen receptor beta | 98.01% | 98.35% |
CHEMBL2581 | P07339 | Cathepsin D | 93.84% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.81% | 91.11% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 91.67% | 93.10% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 91.22% | 91.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.92% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.34% | 90.00% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 85.76% | 97.64% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.28% | 86.92% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.03% | 94.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.88% | 93.99% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 81.73% | 96.12% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.72% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.53% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.46% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.66% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Selaginella tamariscina |
PubChem | 16664188 |
NPASS | NPC35341 |
ChEMBL | CHEMBL3394769 |