Secaubrytriol
| Internal ID | a280e67e-1d22-44d7-b819-57500def43f6 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | 3-[(1S,4R,5R,8S,9S,12R,13R)-5-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-12-(3-hydroxyprop-1-en-2-yl)-4,8-dimethyl-13-tetracyclo[7.5.0.01,13.04,8]tetradecanyl]propanoic acid |
| SMILES (Canonical) | CC(CCC(C(C)(C)O)O)C1CCC2(C1(CCC34C2CCC(C3(C4)CCC(=O)O)C(=C)CO)C)C |
| SMILES (Isomeric) | C[C@H](CC[C@H](C(C)(C)O)O)[C@H]1CC[C@@]2([C@@]1(CC[C@]34[C@H]2CC[C@H]([C@]3(C4)CCC(=O)O)C(=C)CO)C)C |
| InChI | InChI=1S/C30H50O5/c1-19(7-10-24(32)26(3,4)35)21-11-13-28(6)23-9-8-22(20(2)17-31)29(14-12-25(33)34)18-30(23,29)16-15-27(21,28)5/h19,21-24,31-32,35H,2,7-18H2,1,3-6H3,(H,33,34)/t19-,21-,22+,23+,24-,27-,28+,29-,30+/m1/s1 |
| InChI Key | NFSDEMPRAKPPFK-HIGWZERASA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C30H50O5 |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.36582469 g/mol |
| Topological Polar Surface Area (TPSA) | 98.00 Ų |
| XlogP | 6.10 |
| 925932-10-1 |
| 3-[(1S,4R,5R,8S,9S,12R,13R)-5-[(2R,5R)-5,6-Dihydroxy-6-methylheptan-2-yl]-12-(3-hydroxyprop-1-en-2-yl)-4,8-dimethyl-13-tetracyclo[7.5.0.01,13.04,8]tetradecanyl]propanoic acid |
| DTXSID401317608 |
| AKOS032962221 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.37% | 97.25% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 97.60% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.36% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.67% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.65% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.06% | 91.11% |
| CHEMBL233 | P35372 | Mu opioid receptor | 89.61% | 97.93% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.20% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.17% | 93.56% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 86.53% | 98.10% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.65% | 96.47% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.84% | 93.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.83% | 100.00% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 84.54% | 94.78% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.12% | 91.19% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 83.43% | 97.86% |
| CHEMBL236 | P41143 | Delta opioid receptor | 83.40% | 99.35% |
| CHEMBL4482 | O96013 | Serine/threonine-protein kinase PAK 4 | 83.29% | 95.42% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.90% | 96.38% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 82.50% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.23% | 97.09% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.91% | 97.14% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.78% | 97.79% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 81.76% | 97.29% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 81.22% | 89.05% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.56% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Gardenia aubryi |
| PubChem | 16099421 |
| LOTUS | LTS0233511 |
| wikiData | Q105178647 |