Scedapin F
| Internal ID | b1259713-a6c8-4dee-8254-31af5739fb86 |
| Taxonomy | Lignans, neolignans and related compounds |
| IUPAC Name | N-[(2S)-4-(3,4-dimethoxyphenyl)-1-(4-methoxyphenyl)-3-oxobutan-2-yl]formamide |
| SMILES (Canonical) | COC1=CC=C(C=C1)CC(C(=O)CC2=CC(=C(C=C2)OC)OC)NC=O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)C[C@@H](C(=O)CC2=CC(=C(C=C2)OC)OC)NC=O |
| InChI | InChI=1S/C20H23NO5/c1-24-16-7-4-14(5-8-16)10-17(21-13-22)18(23)11-15-6-9-19(25-2)20(12-15)26-3/h4-9,12-13,17H,10-11H2,1-3H3,(H,21,22)/t17-/m0/s1 |
| InChI Key | BZHZHBJDEXREKK-KRWDZBQOSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.15762283 g/mol |
| Topological Polar Surface Area (TPSA) | 73.90 Ų |
| XlogP | 2.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1255126 | O15151 | Protein Mdm4 | 98.13% | 90.20% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.65% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.59% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.09% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.10% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.94% | 95.56% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.47% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.84% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.96% | 86.33% |
| CHEMBL1741221 | Q9Y4P1 | Cysteine protease ATG4B | 87.29% | 87.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.22% | 95.89% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.11% | 96.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.05% | 90.17% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.84% | 96.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.60% | 90.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.25% | 85.14% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.01% | 91.07% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.08% | 97.21% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.77% | 91.19% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.76% | 92.62% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.32% | 91.11% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.16% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139591087 |
| LOTUS | LTS0046808 |
| wikiData | Q105120635 |