Sigmoidin B 3'-methyl ether
Internal ID | 68dedbb3-251c-4c5e-89da-91ad7a090089 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 3-prenylated flavans > 3-prenylated flavanones |
IUPAC Name | (2S)-5,7-dihydroxy-2-[3-hydroxy-4-methoxy-5-(3-methylbut-2-enyl)phenyl]-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=CCC1=C(C(=CC(=C1)C2CC(=O)C3=C(C=C(C=C3O2)O)O)O)OC)C |
SMILES (Isomeric) | CC(=CCC1=C(C(=CC(=C1)[C@@H]2CC(=O)C3=C(C=C(C=C3O2)O)O)O)OC)C |
InChI | InChI=1S/C21H22O6/c1-11(2)4-5-12-6-13(7-17(25)21(12)26-3)18-10-16(24)20-15(23)8-14(22)9-19(20)27-18/h4,6-9,18,22-23,25H,5,10H2,1-3H3/t18-/m0/s1 |
InChI Key | UYGBXGAZUCKDDV-SFHVURJKSA-N |
Popularity | 5 references in papers |
Molecular Formula | C21H22O6 |
Molecular Weight | 370.40 g/mol |
Exact Mass | 370.14163842 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 4.30 |
Sigmoidin B 3'-methyl ether |
114340-00-0 |
(S)-2,3-Dihydro-5,7-dihydroxy-2-(4-hydroxy-3-methoxy-5-(3-methyl-2-butenyl)phenyl)-4H-1-benzopyran-4-one |
2,3-Dihydro-5,7-dihydroxy-2-(4-hydroxy-5-methoxy-3-(3-methyl-2-butenyl)phenyl)-4H-1-benzopyran-4-one |
4H-1-Benzopyran-4-one, 2,3-dihydro-5,7-dihydroxy-2-(4-hydroxy-3-methoxy-5-(3-methyl-2-butenyl)phenyl)-, (S)- |
(2S)-5,7-dihydroxy-2-[3-hydroxy-4-methoxy-5-(3-methylbut-2-enyl)phenyl]-2,3-dihydrochromen-4-one |
DTXSID70150708 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.61% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.36% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.09% | 96.09% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 94.07% | 96.12% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.25% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 90.26% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.10% | 97.09% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 89.35% | 92.68% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.66% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.40% | 99.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.81% | 99.23% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.93% | 83.82% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.01% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.95% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.91% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.36% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.52% | 92.62% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.14% | 96.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.73% | 94.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.72% | 100.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.16% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Erythrina berteroana |
Erythrina burttii |
Erythrina sacleuxii |
Erythrina velutina |
PubChem | 3082688 |
LOTUS | LTS0075863 |
wikiData | Q83016892 |