Sativene Epoxide
| Internal ID | 4c0a93c0-fbff-40d6-b65a-9bbd8a4914d3 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (1'S,2S,2'S,3'R,6'R,8'S,9'S,10'R)-6'-methyl-3'-propan-2-ylspiro[oxirane-2,7'-tricyclo[4.4.0.02,8]decane]-9',10'-diol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H24O3/c1-7(2)8-4-5-14(3)10-9(8)11(13(17)12(10)16)15(14)6-18-15/h7-13,16-17H,4-6H2,1-3H3/t8-,9+,10-,11+,12-,13+,14-,15+/m1/s1 |
| InChI Key | VHMNAPBFMHCKLZ-JUIPADMUSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17254462 g/mol |
| Topological Polar Surface Area (TPSA) | 53.00 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.67% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.10% | 91.11% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 89.65% | 97.47% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 89.63% | 95.71% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.40% | 97.25% |
| CHEMBL3983 | P33981 | Dual specificity protein kinase TTK | 87.80% | 98.99% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.71% | 96.77% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.41% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.38% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.06% | 100.00% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 85.90% | 89.05% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.44% | 95.89% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.86% | 96.38% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 84.62% | 97.79% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.34% | 98.75% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.74% | 96.47% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.31% | 95.93% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.16% | 82.69% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.94% | 92.62% |
| CHEMBL260 | Q16539 | MAP kinase p38 alpha | 80.77% | 97.78% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.10% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139584322 |
| LOTUS | LTS0121918 |
| wikiData | Q77310238 |